Introduction：Basic information about CAS 501015-32-3|fmoc-(s)-3-amino-3-(3-hydroxy-phenyl)-propionic acid, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | fmoc-(s)-3-amino-3-(3-hydroxy-phenyl)-propionic acid |
|---|
| CAS Number | 501015-32-3 | Molecular Weight | 403.427 |
|---|
| Density | 1.3±0.1 g/cm3 | Boiling Point | 675.0±55.0 °C at 760 mmHg |
|---|
| Molecular Formula | C24H21NO5 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 362.0±31.5 °C |
|---|
Names
| Name | (3S)-3-(9H-fluoren-9-ylmethoxycarbonylamino)-3-(3-hydroxyphenyl)propanoic acid |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.3±0.1 g/cm3 |
|---|
| Boiling Point | 675.0±55.0 °C at 760 mmHg |
|---|
| Molecular Formula | C24H21NO5 |
|---|
| Molecular Weight | 403.427 |
|---|
| Flash Point | 362.0±31.5 °C |
|---|
| Exact Mass | 403.141968 |
|---|
| PSA | 95.86000 |
|---|
| LogP | 4.42 |
|---|
| Vapour Pressure | 0.0±2.2 mmHg at 25°C |
|---|
| Index of Refraction | 1.651 |
|---|
| InChIKey | LZJDAHKCUYUTCN-QFIPXVFZSA-N |
|---|
| SMILES | O=C(O)CC(NC(=O)OCC1c2ccccc2-c2ccccc21)c1cccc(O)c1 |
|---|
Synonyms
| (3S)-3-{[(9H-Fluoren-9-ylmethoxy)carbonyl]amino}-3-(3-hydroxyphenyl)propanoic acid |
| Benzenepropanoic acid, β-[[(9H-fluoren-9-ylmethoxy)carbonyl]amino]-3-hydroxy-, (βS)- |
| Fmoc-(S)-3-Amino-3-(3-hydroxy-phenyl)-propionic acid |
| (S)-3-((((9H-Fluoren-9-yl)methoxy)carbonyl)amino)-3-(3-hydroxyphenyl)propanoic acid |
| Fmoc-3-hydroxy-L-b-phenylalanine |
