Introduction:Basic information about CAS 66605-58-1|Boc-Tyr(bzl)-Ol, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Boc-Tyr(bzl)-Ol |
|---|
| CAS Number | 66605-58-1 | Molecular Weight | 357.44300 |
|---|
| Density | 1.130±0.06 g/cm3 | Boiling Point | 536.1℃ at 760 mmHg |
|---|
| Molecular Formula | C21H27NO4 | Melting Point | 103-105℃ |
|---|
| MSDS | / | Flash Point | / |
|---|
Names
| Name | tert-butyl N-[(2S)-1-hydroxy-3-(4-phenylmethoxyphenyl)propan-2-yl]carbamate |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.130±0.06 g/cm3 |
|---|
| Boiling Point | 536.1℃ at 760 mmHg |
|---|
| Melting Point | 103-105℃ |
|---|
| Molecular Formula | C21H27NO4 |
|---|
| Molecular Weight | 357.44300 |
|---|
| Exact Mass | 357.19400 |
|---|
| PSA | 67.79000 |
|---|
| LogP | 4.08460 |
|---|
| InChIKey | FOMAWYQEBPYJJU-SFHVURJKSA-N |
|---|
| SMILES | CC(C)(C)OC(=O)NC(CO)Cc1ccc(OCc2ccccc2)cc1 |
|---|
Safety Information
| Hazard Codes | Xi |
|---|
| HS Code | 2924299090 |
|---|
Customs
| HS Code | 2924299090 |
|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
|---|
Synonyms
| N-Boc-O-benzyl-L-tyrosinol |
| Boc-(S)-2-amino-3-[4-(phenylmethoxy)phenyl]-1-propanol |
| Carbamic acid,[(1S)-1-(hydroxymethyl)-2-[4-(phenylmethoxy)phenyl]ethyl]-,1,1-dimethylethyl ester(9CI) |
| O-benzyl-N-tert-butoxycarbonyl-L-tyrosinol |
| (2S)-2-N-Boc-amino-3-(4-benzyloxyphenyl)propanol |
| (S)-[1-(4-benzyloxybenzyl)-2-hydroxyethyl]carbamic acid tert-butyl ester |
| 2(S)-<(tert-butoxycarbonyl)amino>-3-<4-(phenylmethoxy)phenyl>propanol |
| AmbotzBAL1046 |
| Carbamic acid,[1-(hydroxymethyl)-2-[4-(phenylmethoxy)phenyl]ethyl]-,1,1-dimethylethyl ester,(S) |
| BOC-TYR(BZL)-OL |
| Carbamic acid,N-[(1S)-1-(hydroxymethyl)-2-[4-(phenylmethoxy)phenyl]ethyl]-,1,1-dimethylethyl ester |
| VT1019 |