Introduction：Basic information about CAS 105496-31-9|Fmoc-Gly-ol, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Fmoc-Gly-ol |
|---|
| CAS Number | 105496-31-9 | Molecular Weight | 283.322 |
|---|
| Density | 1.2±0.1 g/cm3 | Boiling Point | 502.7±33.0 °C at 760 mmHg |
|---|
| Molecular Formula | C17H17NO3 | Melting Point | 144-147 °C(lit.) |
|---|
| MSDS | ChineseUSA | Flash Point | 257.8±25.4 °C |
|---|
| Symbol |
GHS07 | Signal Word | Warning |
|---|
Names
| Name | 9H-fluoren-9-ylmethyl N-(2-hydroxyethyl)carbamate |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.2±0.1 g/cm3 |
|---|
| Boiling Point | 502.7±33.0 °C at 760 mmHg |
|---|
| Melting Point | 144-147 °C(lit.) |
|---|
| Molecular Formula | C17H17NO3 |
|---|
| Molecular Weight | 283.322 |
|---|
| Flash Point | 257.8±25.4 °C |
|---|
| Exact Mass | 283.120850 |
|---|
| PSA | 58.56000 |
|---|
| LogP | 2.93 |
|---|
| Vapour Pressure | 0.0±1.4 mmHg at 25°C |
|---|
| Index of Refraction | 1.610 |
|---|
| InChIKey | XLIFWDZVNRWYKV-UHFFFAOYSA-N |
|---|
| SMILES | O=C(NCCO)OCC1c2ccccc2-c2ccccc21 |
|---|
| Storage condition | 2-8°C |
|---|
Safety Information
| Symbol |
GHS07 |
|---|
| Signal Word | Warning |
|---|
| Hazard Statements | H315-H319-H335 |
|---|
| Precautionary Statements | P261-P305 + P351 + P338 |
|---|
| Personal Protective Equipment | dust mask type N95 (US);Eyeshields;Gloves |
|---|
| Hazard Codes | Xi: Irritant; |
|---|
| Risk Phrases | R36/37/38 |
|---|
| Safety Phrases | S26-S36 |
|---|
| RIDADR | NONH for all modes of transport |
|---|
| WGK Germany | 3 |
|---|
| HS Code | 2924299090 |
|---|
Customs
| HS Code | 2924299090 |
|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
|---|
Synonyms
| 9H-Fluoren-9-ylmethyl (2-hydroxyethyl)carbamate |
| Fmoc-glycinol |
| Fmoc-ethanolamine |
| N-fmoc-aminoethanol |
| 2-[(9H-Fluoren-9-ylmethoxy)carbonylamino]-1-ethanol |
| Fmoc-Gly-ol |
| Fmoc-aminoethanol |
| 9H-9-fluorenylmethyl N-(2-hydroxyethyl)carbamate |
| N-Fmoc-ethanolamine |
| 9-Fluorenylmethyl N-(2-hydroxyethyl)carbamate |
| Carbamic acid, N-(2-hydroxyethyl)-, 9H-fluoren-9-ylmethyl ester |
| 2-(Fmoc-amino)-1-ethanol |
| 2-(Fmoc-amino)ethanol |
| MFCD00235927 |
| FMOC-GLYCINOL |
