Introduction：Basic information about CAS 94001-65-7|1-(4-methoxyphenyl)-1-phenylethanol, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 1-(4-methoxyphenyl)-1-phenylethanol |
|---|
| CAS Number | 94001-65-7 | Molecular Weight | 228.28600 |
|---|
| Density | 1.099g/cm3 | Boiling Point | 371.6ºC at 760 mmHg |
|---|
| Molecular Formula | C15H16O2 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 164.9ºC |
|---|
Names
| Name | 1-(4-methoxyphenyl)-1-phenylethanol |
|---|
Chemical & Physical Properties
| Density | 1.099g/cm3 |
|---|
| Boiling Point | 371.6ºC at 760 mmHg |
|---|
| Molecular Formula | C15H16O2 |
|---|
| Molecular Weight | 228.28600 |
|---|
| Flash Point | 164.9ºC |
|---|
| Exact Mass | 228.11500 |
|---|
| PSA | 29.46000 |
|---|
| LogP | 2.95100 |
|---|
| Index of Refraction | 1.568 |
|---|
| InChIKey | RYESRDXJZHXPKV-UHFFFAOYSA-N |
|---|
| SMILES | COc1ccc(C(C)(O)c2ccccc2)cc1 |
|---|
