Introduction：Basic information about CAS 10560-13-1|Diethyl 5-nitroisophthalate, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Diethyl 5-nitroisophthalate |
|---|
| CAS Number | 10560-13-1 | Molecular Weight | 267.23500 |
|---|
| Density | 1.272 g/cm3 | Boiling Point | 384.4ºC at 760 mmHg |
|---|
| Molecular Formula | C12H13NO6 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 164ºC |
|---|
Names
| Name | Diethyl 5-nitroisophthalate |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.272 g/cm3 |
|---|
| Boiling Point | 384.4ºC at 760 mmHg |
|---|
| Molecular Formula | C12H13NO6 |
|---|
| Molecular Weight | 267.23500 |
|---|
| Flash Point | 164ºC |
|---|
| Exact Mass | 267.07400 |
|---|
| PSA | 98.42000 |
|---|
| LogP | 2.47140 |
|---|
| Vapour Pressure | 1.15E-05mmHg at 25°C |
|---|
| Index of Refraction | 1.537 |
|---|
| InChIKey | PYBFOSCCWZPUSC-UHFFFAOYSA-N |
|---|
| SMILES | CCOC(=O)c1cc(C(=O)OCC)cc([N+](=O)[O-])c1 |
|---|
Safety Information
Customs
| HS Code | 2917399090 |
|---|
| Summary | 2917399090 aromatic polycarboxylic acids, their anhydrides, halides, peroxides, peroxyacids and their derivatives。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:30.0% |
|---|
Synonyms
| diethyl-5-nitro-benzene-1,3-dicarboxylate |
| 5-nitro-1,3-benzenedicarboxylic acid,diethyl ester |
| diethyl 5-nitro-isophthalate |
| Einecs 234-144-2 |
| MFCD00127680 |
| 5-Nitro-isophthalsaeure-diaethylester |
| 5-nitro-isophthalic acid diethyl ester |
