Introduction:Basic information about CAS 76820-34-3|N,N'-Bis(2,3-dihydroxypropyl)-5-nitro-1,3-benzenedicarboxamide, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | N,N'-Bis(2,3-dihydroxypropyl)-5-nitro-1,3-benzenedicarboxamide |
|---|
| CAS Number | 76820-34-3 | Molecular Weight | 357.31600 |
|---|
| Density | 1.189 g/mL | Boiling Point | 50ºC |
|---|
| Molecular Formula | C14H19N3O8 | Melting Point | / |
|---|
| MSDS | / | Flash Point | >230ºC |
|---|
Names
| Name | 1-N,3-N-bis(2,3-dihydroxypropyl)-5-nitrobenzene-1,3-dicarboxamide |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.189 g/mL |
|---|
| Boiling Point | 50ºC |
|---|
| Molecular Formula | C14H19N3O8 |
|---|
| Molecular Weight | 357.31600 |
|---|
| Flash Point | >230ºC |
|---|
| Exact Mass | 357.11700 |
|---|
| PSA | 184.94000 |
|---|
| Index of Refraction | 1.627 |
|---|
| InChIKey | LJEBHEAPZMNBSI-UHFFFAOYSA-N |
|---|
| SMILES | O=C(NCC(O)CO)c1cc(C(=O)NCC(O)CO)cc([N+](=O)[O-])c1 |
|---|
Safety Information
| Hazard Codes | C: Corrosive; |
|---|
| Risk Phrases | R34 |
|---|
| Safety Phrases | 26-36/37/39-45 |
|---|
| RIDADR | NONH for all modes of transport |
|---|
| HS Code | 2924299090 |
|---|
Customs
| HS Code | 2924299090 |
|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
|---|
Synonyms
| 5-nitro-N,N'-bis-(2,3-dihydroxypropyl)isophthalamide |
| 5-nitroisophthalic acid mono-(2,3-dihydroxy-propyl) amide |
| MFCD08063356 |
| 5-Nitro-N,N'-Bis(2,3-dihydroxypropyl) |
| N1,N3-Bis(2,3-dihydroxypropyl)-5-nitroisophthalamide |
| N,N'-bis(2,3-dihydroxy-propyl)-5-nitro-isophthalamide |
| N'-bis(2,3-dihydroxypropyl)isophthalamide |
| N,N'-Bis(2,3-dihydroxypropyl)-5-nitro-1,3-benzenedicarboxamide |