Introduction:Basic information about CAS 28924-21-2|3',5'-Dibenzyloxyacetophenone, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 3',5'-Dibenzyloxyacetophenone |
|---|
| CAS Number | 28924-21-2 | Molecular Weight | 332.39200 |
|---|
| Density | 1.144 g/cm3 | Boiling Point | 489.5ºC at 760 mmHg |
|---|
| Molecular Formula | C22H20O3 | Melting Point | 60-64 ºC |
|---|
| MSDS | ChineseUSA | Flash Point | 242.1ºC |
|---|
Names
| Name | 1-[3,5-bis(phenylmethoxy)phenyl]ethanone |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.144 g/cm3 |
|---|
| Boiling Point | 489.5ºC at 760 mmHg |
|---|
| Melting Point | 60-64 ºC |
|---|
| Molecular Formula | C22H20O3 |
|---|
| Molecular Weight | 332.39200 |
|---|
| Flash Point | 242.1ºC |
|---|
| Exact Mass | 332.14100 |
|---|
| PSA | 35.53000 |
|---|
| LogP | 5.04720 |
|---|
| Vapour Pressure | 9.94E-10mmHg at 25°C |
|---|
| Index of Refraction | 1.594 |
|---|
| InChIKey | KOJXGMJOTRYLBD-UHFFFAOYSA-N |
|---|
| SMILES | CC(=O)c1cc(OCc2ccccc2)cc(OCc2ccccc2)c1 |
|---|
| Storage condition | -20°C Freezer |
|---|
Safety Information
| Personal Protective Equipment | Eyeshields;Gloves;type N95 (US);type P1 (EN143) respirator filter |
|---|
| Hazard Codes | Xi: Irritant; |
|---|
| Safety Phrases | S24/25 |
|---|
| RIDADR | NONH for all modes of transport |
|---|
| WGK Germany | 3 |
|---|
| HS Code | 2914509090 |
|---|
Customs
| HS Code | 2914509090 |
|---|
| Summary | HS:2914509090 other ketones with other oxygen function VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:5.5% General tariff:30.0% |
|---|
Synonyms
| 3,5-Dibenzyloxyacetophenone |
| EINECS 249-315-7 |
| 2',5'-dibenzyloxyacetophenone |
| 1-(3,5-Bis(benzyloxy)phenyl)ethanone |
| 3',5'-Dibenzyloxyacetophenone |
| MFCD00004777 |
| 3,5-dibenzyloxy-acetophenone |
| 3',5'-Bis(benzyloxy)acetophenone |
| 5-acetyl-1,3-phenylene dibenzoate |
| Terbutaline Impurity 5 |