Introduction：Basic information about CAS 17019-01-1|UNII:F1Q1E0G45A, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | UNII:F1Q1E0G45A |
|---|
| CAS Number | 17019-01-1 | Molecular Weight | 216.279 |
|---|
| Density | 1.1±0.1 g/cm3 | Boiling Point | 399.2±37.0 °C at 760 mmHg |
|---|
| Molecular Formula | C13H16N2O | Melting Point | / |
|---|
| MSDS | / | Flash Point | 195.2±26.5 °C |
|---|
Names
| Name | tetrahydroharmine |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.1±0.1 g/cm3 |
|---|
| Boiling Point | 399.2±37.0 °C at 760 mmHg |
|---|
| Molecular Formula | C13H16N2O |
|---|
| Molecular Weight | 216.279 |
|---|
| Flash Point | 195.2±26.5 °C |
|---|
| Exact Mass | 216.126266 |
|---|
| PSA | 37.05000 |
|---|
| LogP | 1.68 |
|---|
| Vapour Pressure | 0.0±0.9 mmHg at 25°C |
|---|
| Index of Refraction | 1.610 |
|---|
| InChIKey | ZXLDQJLIBNPEFJ-UHFFFAOYSA-N |
|---|
| SMILES | COc1ccc2c3c([nH]c2c1)C(C)NCC3 |
|---|
Synonyms
| 1H-Pyrido[3,4-b]indole, 2,3,4,9-tetrahydro-7-methoxy-1-methyl- |
| UNII:F1Q1E0G45A |
| tetrahydroharmane |
| 7-Methoxy-1-methyl-2,3,4,9-tetrahydro-1H-β-carboline |
| 1,2,3,4-Tetrahydroharmine |
| Tetrahydroharmin |
