Introduction:Basic information about CAS 5027-32-7|2,5-Hexanedione,3,4-diacetyl-, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 2,5-Hexanedione,3,4-diacetyl- |
|---|
| CAS Number | 5027-32-7 | Molecular Weight | 198.21600 |
|---|
| Density | 1.084g/cm3 | Boiling Point | 355.7ºC at 760mmHg |
|---|
| Molecular Formula | C10H14O4 | Melting Point | 193 °C |
|---|
| MSDS | / | Flash Point | 146.9ºC |
|---|
Names
| Name | 3,4-diacetylhexane-2,5-dione |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.084g/cm3 |
|---|
| Boiling Point | 355.7ºC at 760mmHg |
|---|
| Melting Point | 193 °C |
|---|
| Molecular Formula | C10H14O4 |
|---|
| Molecular Weight | 198.21600 |
|---|
| Flash Point | 146.9ºC |
|---|
| Exact Mass | 198.08900 |
|---|
| PSA | 68.28000 |
|---|
| LogP | 0.57480 |
|---|
| Index of Refraction | 1.442 |
|---|
| InChIKey | CSKRBHOAJUMOKJ-UHFFFAOYSA-N |
|---|
| SMILES | CC(=O)C(C(C)=O)C(C(C)=O)C(C)=O |
|---|
Safety Information
Customs
| HS Code | 2914190090 |
|---|
| Summary | 2914190090 other acyclic ketones without other oxygen function。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:5.5%。General tariff:30.0% |
|---|
Synonyms
| tetraacetylethane |
| 2,3,4-diacetyl |
| 1,1,2,2-ethane tetraacetyl |
| 1,1,2,2-Tetraacetylethane |
| Sym-tetraacetylethane |
| 3,4-diacetylhexan-2,5-dione |
| 3,4-Diacetyl-2,5-hexanedione |
| 3,5-hexanedione |