Introduction：Basic information about CAS 7297-25-8|eritrityl tetranitrate, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | eritrityl tetranitrate |
|---|
| CAS Number | 7297-25-8 | Molecular Weight | 302.11000 |
|---|
| Density | 1.757 g/cm3 | Boiling Point | 381.8ºC at 760 mmHg |
|---|
| Molecular Formula | C4H6N4O12 | Melting Point | 61° |
|---|
| MSDS | / | Flash Point | 178.8ºC |
|---|
Names
| Name | erythrityl tetranitrate |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.757 g/cm3 |
|---|
| Boiling Point | 381.8ºC at 760 mmHg |
|---|
| Melting Point | 61° |
|---|
| Molecular Formula | C4H6N4O12 |
|---|
| Molecular Weight | 302.11000 |
|---|
| Flash Point | 178.8ºC |
|---|
| Exact Mass | 301.99800 |
|---|
| PSA | 220.20000 |
|---|
| LogP | 0.64960 |
|---|
| Index of Refraction | 1.511 |
|---|
| InChIKey | SNFOERUNNSHUGP-ZXZARUISSA-N |
|---|
| SMILES | O=[N+]([O-])OCC(O[N+](=O)[O-])C(CO[N+](=O)[O-])O[N+](=O)[O-] |
|---|
Synonyms
| Tetra-O-nitro-erythrit |
| meso-1,2,3,4-tetrakis-nitryloxy-butane |
| Cardivell |
| Tetranitrin |
| Nitroerythrite |
| Nitroerythrit |
| Erythrol tetranitrate |
| meso-1,2,3,4-Tetrakis-nitryloxy-butan |
| Eritrityl tetranitrate |
| meso-1,2,3,4-tetrakis-nitrooxy-butane |
| Cardiwell |
| 1,3,4-trinitrooxybutan-2-yl nitrate |
| Nitroerythrol |
| erythritol tetranitrate |
| tetra-O-nitro-erythritol |
| Tetranitrol |
| Cardiloid |
