Introduction：Basic information about CAS 69118-25-8|cinepaxadil, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | cinepaxadil |
|---|
| CAS Number | 69118-25-8 | Molecular Weight | 556.60400 |
|---|
| Density | 1.26g/cm3 | Boiling Point | 793.6ºC at 760 mmHg |
|---|
| Molecular Formula | C29H36N2O9 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 433.8ºC |
|---|
Names
| Name | (E)-1-[4-[3-[(8-acetyl-2,3-dihydro-1,4-benzodioxin-5-yl)oxy]-2-hydroxypropyl]piperazin-1-yl]-3-(3,4,5-trimethoxyphenyl)prop-2-en-1-one |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.26g/cm3 |
|---|
| Boiling Point | 793.6ºC at 760 mmHg |
|---|
| Molecular Formula | C29H36N2O9 |
|---|
| Molecular Weight | 556.60400 |
|---|
| Flash Point | 433.8ºC |
|---|
| Exact Mass | 556.24200 |
|---|
| PSA | 116.23000 |
|---|
| LogP | 2.15930 |
|---|
| Index of Refraction | 1.585 |
|---|
| InChIKey | SYFDPNLESAYNCB-VMPITWQZSA-N |
|---|
| SMILES | COc1cc(C=CC(=O)N2CCN(CC(O)COc3ccc(C(C)=O)c4c3OCCO4)CC2)cc(OC)c1OC |
|---|
Synonyms
| UNII-E052L8N506 |
| cinepaxadil |
| EINECS 273-876-7 |
| Cinepaxadilum |
