Introduction：Basic information about CAS 4873-56-7|isobutyl p-toluenesulfonate, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | isobutyl p-toluenesulfonate |
|---|
| CAS Number | 4873-56-7 | Molecular Weight | 228.30800 |
|---|
| Density | 1.12g/cm3 | Boiling Point | 329.1ºC at 760mmHg |
|---|
| Molecular Formula | C11H16O3S | Melting Point | / |
|---|
| MSDS | / | Flash Point | 152.8ºC |
|---|
Names
| Name | 2-methylpropyl 4-methylbenzenesulfonate |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.12g/cm3 |
|---|
| Boiling Point | 329.1ºC at 760mmHg |
|---|
| Molecular Formula | C11H16O3S |
|---|
| Molecular Weight | 228.30800 |
|---|
| Flash Point | 152.8ºC |
|---|
| Exact Mass | 228.08200 |
|---|
| PSA | 51.75000 |
|---|
| LogP | 3.43710 |
|---|
| Index of Refraction | 1.5025 |
|---|
| InChIKey | QIMRPGAQCKHRKB-UHFFFAOYSA-N |
|---|
| SMILES | Cc1ccc(S(=O)(=O)OCC(C)C)cc1 |
|---|
Safety Information
| Risk Phrases | 36/37/38-45 |
|---|
| Safety Phrases | S26-S36-S37-S39 |
|---|
| RIDADR | UN 2811 |
|---|
Synonyms
| p-toluenesulfonic acid isobutyl ester |
| Toluol-4-sulfonsaeure-isobutylester |
| 4-methyl-benzenesulfonic acid,2-methylpropyl ester |
| toluene-4-sulfonic acid isobutyl ester |
| Isopropyl 4-toluene sulphonate |
| MFCD00026478 |
| isobutyl tosylate |
| Isobutyl p-toluenesulfonate |
