Introduction：Basic information about CAS 50917-32-3|5-Amino-2,3-dichlorobenzoic acid, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 5-Amino-2,3-dichlorobenzoic acid |
|---|
| CAS Number | 50917-32-3 | Molecular Weight | 206.02600 |
|---|
| Density | 1.607g/cm3 | Boiling Point | 404.9ºC at 760 mmHg |
|---|
| Molecular Formula | C7H5Cl2NO2 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 198.7ºC |
|---|
Names
| Name | 5-Amino-2,3-dichlorobenzoic acid |
|---|
Chemical & Physical Properties
| Density | 1.607g/cm3 |
|---|
| Boiling Point | 404.9ºC at 760 mmHg |
|---|
| Molecular Formula | C7H5Cl2NO2 |
|---|
| Molecular Weight | 206.02600 |
|---|
| Flash Point | 198.7ºC |
|---|
| Exact Mass | 204.97000 |
|---|
| PSA | 63.32000 |
|---|
| LogP | 2.85500 |
|---|
| Index of Refraction | 1.658 |
|---|
| InChIKey | RYCVUGZLAQJJLC-UHFFFAOYSA-N |
|---|
| SMILES | Nc1cc(Cl)c(Cl)c(C(=O)O)c1 |
|---|
