Introduction：Basic information about CAS 2280-49-1|N-Phenyl-N-((trichloromethyl)thio)benzenesulfonamide, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | N-Phenyl-N-((trichloromethyl)thio)benzenesulfonamide |
|---|
| CAS Number | 2280-49-1 | Molecular Weight | 382.713 |
|---|
| Density | 1.6±0.1 g/cm3 | Boiling Point | 421.7±55.0 °C at 760 mmHg |
|---|
| Molecular Formula | C13H10Cl3NO2S2 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 208.8±31.5 °C |
|---|
Names
| Name | N-phenyl-N-(trichloromethylsulfanyl)benzenesulfonamide |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.6±0.1 g/cm3 |
|---|
| Boiling Point | 421.7±55.0 °C at 760 mmHg |
|---|
| Molecular Formula | C13H10Cl3NO2S2 |
|---|
| Molecular Weight | 382.713 |
|---|
| Flash Point | 208.8±31.5 °C |
|---|
| Exact Mass | 380.921844 |
|---|
| PSA | 71.06000 |
|---|
| LogP | 5.48 |
|---|
| Vapour Pressure | 0.0±1.0 mmHg at 25°C |
|---|
| Index of Refraction | 1.667 |
|---|
| InChIKey | CAXJFBOSFXRPOJ-UHFFFAOYSA-N |
|---|
| SMILES | O=S(=O)(c1ccccc1)N(SC(Cl)(Cl)Cl)c1ccccc1 |
|---|
Safety Information
Customs
| HS Code | 2935009090 |
|---|
| Summary | 2935009090 other sulphonamides VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:35.0% |
|---|
Synonyms
| N-Phenyl-N-((trichloromethyl)thio)benzenesulphonamide |
| N-Phenyl-N-[(trichloromethyl)sulfanyl]benzenesulfonamide |
| N-Phenyl-N-((trichloromethyl)thio)benzenesulfonamide |
| EINECS 218-915-0 |
| Benzenesulfonamide, N-phenyl-N-[(trichloromethyl)thio]- |
| N-(trichloromethylthio)-N-(phenylsulfonyl)-aniline |
| N-Phenyl-N-(trichloromethylsulfenyl)benzene sulfonamide |
| N-Trichlormethansulfenyl-benzolsulfonamid |
| N-benzenesulfonyl-N-trichloromethanesulfenyl-aniline |
| N-Benzolsulfonyl-N-trichlormethansulfenyl-anilin |
| Benzenesulfonamide, N-phenyl-N-((trichloromethyl)thio)- |
