Introduction：Basic information about CAS 1788-10-9|4-Acetylbenzenesulfonyl chloride, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 4-Acetylbenzenesulfonyl chloride |
|---|
| CAS Number | 1788-10-9 | Molecular Weight | 218.657 |
|---|
| Density | 1.4±0.1 g/cm3 | Boiling Point | 338.6±25.0 °C at 760 mmHg |
|---|
| Molecular Formula | C8H7ClO3S | Melting Point | 84-87 °C |
|---|
| MSDS | ChineseUSA | Flash Point | 158.6±23.2 °C |
|---|
| Symbol |
GHS05 | Signal Word | Danger |
|---|
Names
| Name | 4-Acetylbenzenesulfonyl chloride |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.4±0.1 g/cm3 |
|---|
| Boiling Point | 338.6±25.0 °C at 760 mmHg |
|---|
| Melting Point | 84-87 °C |
|---|
| Molecular Formula | C8H7ClO3S |
|---|
| Molecular Weight | 218.657 |
|---|
| Flash Point | 158.6±23.2 °C |
|---|
| Exact Mass | 217.980438 |
|---|
| PSA | 59.59000 |
|---|
| LogP | 1.89 |
|---|
| Vapour Pressure | 0.0±0.7 mmHg at 25°C |
|---|
| Index of Refraction | 1.544 |
|---|
| InChIKey | FXVDNCRTKXMSEZ-UHFFFAOYSA-N |
|---|
| SMILES | CC(=O)c1ccc(S(=O)(=O)Cl)cc1 |
|---|
Safety Information
| Symbol |
GHS05 |
|---|
| Signal Word | Danger |
|---|
| Hazard Statements | H314 |
|---|
| Precautionary Statements | P280-P305 + P351 + P338-P310 |
|---|
| Personal Protective Equipment | Eyeshields;Faceshields;full-face particle respirator type N100 (US);Gloves;respirator cartridge type N100 (US);type P1 (EN143) respirator filter;type P3 (EN 143) respirator cartridges |
|---|
| Hazard Codes | C:Corrosive; |
|---|
| Risk Phrases | R34 |
|---|
| Safety Phrases | S26-S36/37/39-S45-S25 |
|---|
| RIDADR | UN 3261 8/PG 3 |
|---|
| WGK Germany | 3 |
|---|
| HS Code | 29147000 |
|---|
Customs
| HS Code | 2914700090 |
|---|
| Summary | HS: 2914700090 halogenated, sulphonated, nitrated or nitrosated derivatives of ketones and quinones, whether or not with other oxygen function Tax rebate rate:9.0% Supervision conditions:none VAT:17.0% MFN tariff:5.5% General tariff:30.0% |
|---|
Synonyms
| 4-Acetyl-benzenesulfonyl chloride |
| acetophenone-4-sulfonyl chloride |
| p-acetylbenzenesulphonyl chloride |
| 4-Acetylbenzene-1-sulfonyl chloride |
| MFCD00800269 |
| Benzenesulfonyl chloride, 4-acetyl- |
| 4-acetylbenzenesulphonyl chloride |
| 4-Acetylbenzenesulfonyl chloride |
