Introduction：Basic information about CAS 604000-99-9|4-Formyl-3-nitrobenzoic acid, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 4-Formyl-3-nitrobenzoic acid |
|---|
| CAS Number | 604000-99-9 | Molecular Weight | 195.129 |
|---|
| Density | 1.6±0.1 g/cm3 | Boiling Point | 420.2±40.0 °C at 760 mmHg |
|---|
| Molecular Formula | C8H5NO5 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 191.2±15.8 °C |
|---|
Names
| Name | 4-formyl-3-nitrobenzoic acid |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.6±0.1 g/cm3 |
|---|
| Boiling Point | 420.2±40.0 °C at 760 mmHg |
|---|
| Molecular Formula | C8H5NO5 |
|---|
| Molecular Weight | 195.129 |
|---|
| Flash Point | 191.2±15.8 °C |
|---|
| Exact Mass | 195.016769 |
|---|
| PSA | 100.19000 |
|---|
| LogP | 2.05 |
|---|
| Vapour Pressure | 0.0±1.0 mmHg at 25°C |
|---|
| Index of Refraction | 1.663 |
|---|
| InChIKey | NGLYFQZZXYWIRA-UHFFFAOYSA-N |
|---|
| SMILES | O=Cc1ccc(C(=O)O)cc1[N+](=O)[O-] |
|---|
Synonyms
| 4-Formyl-3-nitrobenzoic acid |
| 4-formyl-3-nitro-benzoic acid |
| Benzoic acid, 4-formyl-3-nitro- |
| 4-carboxy-2-nitrobenzaldehyde |
| Benzoic acid,4-formyl-3-nitro-(9CI) |
| 4-Formyl-3-nitro-benzoesaeure |
