Introduction:Basic information about CAS 93372-16-8|3,3'-Bis(5,6-diphenyl-1,2,4-triazine), including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 3,3'-Bis(5,6-diphenyl-1,2,4-triazine) |
|---|
| CAS Number | 93372-16-8 | Molecular Weight | 464.52000 |
|---|
| Density | 1.238g/cm3 | Boiling Point | 693.1ºC at 760mmHg |
|---|
| Molecular Formula | C30H20N6 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 300.3ºC |
|---|
Names
| Name | 3-(5,6-diphenyl-1,2,4-triazin-3-yl)-5,6-diphenyl-1,2,4-triazine |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.238g/cm3 |
|---|
| Boiling Point | 693.1ºC at 760mmHg |
|---|
| Molecular Formula | C30H20N6 |
|---|
| Molecular Weight | 464.52000 |
|---|
| Flash Point | 300.3ºC |
|---|
| Exact Mass | 464.17500 |
|---|
| PSA | 77.34000 |
|---|
| LogP | 6.39160 |
|---|
| Index of Refraction | 1.655 |
|---|
| InChIKey | QQFAPSRWCWFNGN-UHFFFAOYSA-N |
|---|
| SMILES | c1ccc(-c2nnc(-c3nnc(-c4ccccc4)c(-c4ccccc4)n3)nc2-c2ccccc2)cc1 |
|---|
Safety Information
Customs
| HS Code | 2933699090 |
|---|
| Summary | 2933699090 other compounds containing an unfused triazine ring (whether or not hydrogenated) in the structure。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:20.0% |
|---|
Synonyms
| 5,5',6,6'-tetraphenyl-3,3'-bi-1,2,4-triazine |
| 3,3'-Bis(5,6-diphenyl-1,2,4-triazin) |
| 5,6,5',6'-tetraphenyl-[3,3']bi[1,2,4]triazinyl |
| 3,3'-Bi-1,2,4-triazine,5,5',6,6'-tetraphenyl |
| 3,3'-Bi-1,2,4-triazin,5,5',6,6'-tetraphenyl |
| bis-(5,6-diphenyl-[1,2,4]-triazinyl)pyridine |
| 3,3'-bis(5,6-diphenyl)-1,2,4-triazine |