Introduction：Basic information about CAS 24108-44-9|3,5,6-Triphenyl-1,2,4-triazine, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 3,5,6-Triphenyl-1,2,4-triazine |
|---|
| CAS Number | 24108-44-9 | Molecular Weight | 309.36400 |
|---|
| Density | 1.167g/cm3 | Boiling Point | 504ºC at 760mmHg |
|---|
| Molecular Formula | C21H15N3 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 225.2ºC |
|---|
Names
| Name | 3,5,6-Triphenyl-1,2,4-triazine |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.167g/cm3 |
|---|
| Boiling Point | 504ºC at 760mmHg |
|---|
| Molecular Formula | C21H15N3 |
|---|
| Molecular Weight | 309.36400 |
|---|
| Flash Point | 225.2ºC |
|---|
| Exact Mass | 309.12700 |
|---|
| PSA | 38.67000 |
|---|
| LogP | 4.87260 |
|---|
| Vapour Pressure | 8.65E-10mmHg at 25°C |
|---|
| Index of Refraction | 1.63 |
|---|
| InChIKey | IMJWQBWRRPZDAZ-UHFFFAOYSA-N |
|---|
| SMILES | c1ccc(-c2nnc(-c3ccccc3)c(-c3ccccc3)n2)cc1 |
|---|
Safety Information
Customs
| HS Code | 2933699090 |
|---|
| Summary | 2933699090 other compounds containing an unfused triazine ring (whether or not hydrogenated) in the structure。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:20.0% |
|---|
Synonyms
| 1,2,4-Triazine,3,5,6-triphenyl |
| 3,5,6-Triphenyl-as-triazin |
| 3,5,6-triphenyl-[1,2,4]triazine |
| Triphenyl-[1,2,4]triazin |
| as-Triazine,3,5,6-triphenyl-(6CI,7CI,8CI) |
| 2,4,5-Triphenyl-pyrimidin |
| 3,5,6-Triphenyl-1,2,4-triazin |
| 3,5,6-Triphenyl-as-triazine |
