Introduction：Basic information about CAS 10078-27-0|Prochlorperazine Sulfoxide, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Prochlorperazine Sulfoxide |
|---|
| CAS Number | 10078-27-0 | Molecular Weight | 397.99100 |
|---|
| Density | 1.37g/cm3 | Boiling Point | 569.7ºC at 760mmHg |
|---|
| Molecular Formula | C20H16ClD8N3OS | Melting Point | 164-165ºC |
|---|
| MSDS | / | Flash Point | 298.3ºC |
|---|
Names
| Name | 2-chloro-10-[3-(4-methylpiperazin-1-yl)propyl]phenothiazine 5-oxide |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.37g/cm3 |
|---|
| Boiling Point | 569.7ºC at 760mmHg |
|---|
| Melting Point | 164-165ºC |
|---|
| Molecular Formula | C20H16ClD8N3OS |
|---|
| Molecular Weight | 397.99100 |
|---|
| Flash Point | 298.3ºC |
|---|
| Exact Mass | 397.18300 |
|---|
| PSA | 46.00000 |
|---|
| LogP | 4.40220 |
|---|
| Vapour Pressure | 5.45E-13mmHg at 25°C |
|---|
| Index of Refraction | 1.703 |
|---|
| InChIKey | AZGYHFQQUZPAFZ-UHFFFAOYSA-N |
|---|
| SMILES | CN1CCN(CCCN2c3ccccc3S(=O)c3ccc(Cl)cc32)CC1 |
|---|
| Storage condition | 2-8°C |
|---|
Synonyms
| 2-Chloro-10-[3-(4-methyl-1-piperazinyl)propyl]-10H-phenothiazine 5-Oxide |
| 2-chloro-10<3-(1-methyl-4-piperazinyl)-propyl>phenothiazine 5-oxide |
| 10H-Phenothiazine,2-chloro-10-(3-(4-methyl-1-piperazinyl)propyl)-,5-oxide |
| 2-chloro-10-[3-(4-methyl-piperazin-1-yl)-propyl]-10H-phenothiazine 5-oxide |
| Prochlorperazinsulfoxid |
| Prochlorperazine Sulfoxide |
