Introduction：Basic information about CAS 27684-84-0|5-Bromo-2-nitrophenol, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 5-Bromo-2-nitrophenol |
|---|
| CAS Number | 27684-84-0 | Molecular Weight | 218.005 |
|---|
| Density | 1.9±0.1 g/cm3 | Boiling Point | 264.6±20.0 °C at 760 mmHg |
|---|
| Molecular Formula | C6H4BrNO3 | Melting Point | 40-42ºC |
|---|
| MSDS | USA | Flash Point | 113.8±21.8 °C |
|---|
| Symbol |
GHS07 | Signal Word | Warning |
|---|
Names
| Name | 5-Bromo-2-nitrophenol |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.9±0.1 g/cm3 |
|---|
| Boiling Point | 264.6±20.0 °C at 760 mmHg |
|---|
| Melting Point | 40-42ºC |
|---|
| Molecular Formula | C6H4BrNO3 |
|---|
| Molecular Weight | 218.005 |
|---|
| Flash Point | 113.8±21.8 °C |
|---|
| Exact Mass | 216.937454 |
|---|
| PSA | 66.05000 |
|---|
| LogP | 2.69 |
|---|
| Vapour Pressure | 0.0±0.6 mmHg at 25°C |
|---|
| Index of Refraction | 1.652 |
|---|
| InChIKey | DTWHNSNSUBKGTC-UHFFFAOYSA-N |
|---|
| SMILES | O=[N+]([O-])c1ccc(Br)cc1O |
|---|
Safety Information
| Symbol |
GHS07 |
|---|
| Signal Word | Warning |
|---|
| Hazard Statements | H302 |
|---|
| Hazard Codes | Xi |
|---|
| RIDADR | NONH for all modes of transport |
|---|
| HS Code | 2908999090 |
|---|
Customs
| HS Code | 2908999090 |
|---|
| Summary | 2908999090 halogenated, sulphonated, nitrated or nitrosated derivatives of phenols or phenol-alcohols。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:5.5%。General tariff:30.0% |
|---|
Synonyms
| 3-Bromo-6-nitrophenol |
| Phenol,5-bromo-2-nitro |
| 5-Brom-2-nitro-phenol |
| WNR BQ DE |
| Phenol, 5-bromo-2-nitro- |
| 5-Bromo-2-nitrophenol |
| 4-Bromo-2-hydroxynitrobenzene |
| 5-Brom-2-nitro-1-hydroxy-benzol |
| 5-bromo-2-nitro-phenol |
