Introduction:Basic information about CAS 937796-01-5|1-[4-(3-bromothiophen-2-yl)phenyl]ethanone, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 1-[4-(3-bromothiophen-2-yl)phenyl]ethanone |
|---|
| CAS Number | 937796-01-5 | Molecular Weight | 281.16800 |
|---|
| Density | 1.465g/cm3 | Boiling Point | 353.5ºC at 760 mmHg |
|---|
| Molecular Formula | C12H9BrOS | Melting Point | 71.5-73ºC |
|---|
| MSDS | / | Flash Point | 167.6ºC |
|---|
Names
| Name | 1-[4-(3-bromothiophen-2-yl)phenyl]ethanone |
|---|
Chemical & Physical Properties
| Density | 1.465g/cm3 |
|---|
| Boiling Point | 353.5ºC at 760 mmHg |
|---|
| Melting Point | 71.5-73ºC |
|---|
| Molecular Formula | C12H9BrOS |
|---|
| Molecular Weight | 281.16800 |
|---|
| Flash Point | 167.6ºC |
|---|
| Exact Mass | 279.95600 |
|---|
| PSA | 45.31000 |
|---|
| LogP | 4.38020 |
|---|
| Index of Refraction | 1.614 |
|---|
| InChIKey | AMADTVLVNSCDKW-UHFFFAOYSA-N |
|---|
| SMILES | CC(=O)c1ccc(-c2sccc2Br)cc1 |
|---|