Introduction：Basic information about CAS 17264-74-3|sodium,2-chlorobenzoate, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | sodium,2-chlorobenzoate |
|---|
| CAS Number | 17264-74-3 | Molecular Weight | 178.54800 |
|---|
| Density | / | Boiling Point | 275.7ºC at 760mmHg |
|---|
| Molecular Formula | C7H4ClNaO2 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 120.5ºC |
|---|
Names
| Name | sodium,2-chlorobenzoate |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Boiling Point | 275.7ºC at 760mmHg |
|---|
| Molecular Formula | C7H4ClNaO2 |
|---|
| Molecular Weight | 178.54800 |
|---|
| Flash Point | 120.5ºC |
|---|
| Exact Mass | 177.98000 |
|---|
| PSA | 40.13000 |
|---|
| LogP | 0.70350 |
|---|
| Vapour Pressure | 0.00242mmHg at 25°C |
|---|
| InChIKey | OJLSABVGUWNJKD-UHFFFAOYSA-M |
|---|
| SMILES | O=C([O-])c1ccccc1Cl.[Na+] |
|---|
Safety Information
Customs
| HS Code | 2916399090 |
|---|
| Summary | 2916399090 other aromatic monocarboxylic acids, their anhydrides, halides, peroxides, peroxyacids and their derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
|---|
Synonyms
| sodium 2-chlorobenzoate |
| OR5177X |
| o-Chlorobenzoic acid sodiumsalt |
| sodium chlorobenzoate |
| sodium o-chlorobenzoate |
| Benzoic acid,2-chloro-,sodium salt |
| o-chloro-sodium benzoate |
| EINECS 241-297-9 |
| 2-chloro-benzoic acid,sodium salt |
