Introduction：Basic information about CAS 1110-78-7|Hexaphenyl cyclotriphosphazene, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Hexaphenyl cyclotriphosphazene |
|---|
| CAS Number | 1110-78-7 | Molecular Weight | 597.56500 |
|---|
| Density | 1.22 | Boiling Point | / |
|---|
| Molecular Formula | C36H30N3P3 | Melting Point | / |
|---|
| MSDS | / | Flash Point | / |
|---|
Names
| Name | 2,2,4,4,6,6-hexakis-phenyl-1,3,5-triaza-2λ5,4λ5,6λ5-triphosphacyclohexa-1,3,5-triene |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.22 |
|---|
| Molecular Formula | C36H30N3P3 |
|---|
| Molecular Weight | 597.56500 |
|---|
| Exact Mass | 597.16500 |
|---|
| PSA | 66.51000 |
|---|
| LogP | 6.60840 |
|---|
| Index of Refraction | 1.662 |
|---|
| InChIKey | FUGJJMVGGAWCAU-UHFFFAOYSA-N |
|---|
| SMILES | c1ccc(P2(c3ccccc3)=NP(c3ccccc3)(c3ccccc3)=NP(c3ccccc3)(c3ccccc3)=N2)cc1 |
|---|
Synonyms
| Hexaphenyl cyclotriphosphazene |
| 2,2,4,4,6,6-hexaphenylcyclotriphosphazene |
| 2,2,4,4,6,6-hexaphenyl-1,3,5,2|E5,4|E5,6|E5-triazatriphosphinine |
| 2,2,4,4,6,6-hexakis-phenyl-1,3,5-triaza-2 |
| Hexaphenyl-triphosphornitril |
