Introduction：Basic information about CAS 20264-95-3|1-(2-Chloroethyl)-4-nitrobenzene, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 1-(2-Chloroethyl)-4-nitrobenzene |
|---|
| CAS Number | 20264-95-3 | Molecular Weight | 185.60800 |
|---|
| Density | 1.275g/cm3 | Boiling Point | 307.5ºC at 760 mmHg |
|---|
| Molecular Formula | C8H8ClNO2 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 139.8ºC |
|---|
Names
| Name | 1-(2-chloroethyl)-4-nitrobenzene |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.275g/cm3 |
|---|
| Boiling Point | 307.5ºC at 760 mmHg |
|---|
| Molecular Formula | C8H8ClNO2 |
|---|
| Molecular Weight | 185.60800 |
|---|
| Flash Point | 139.8ºC |
|---|
| Exact Mass | 185.02400 |
|---|
| PSA | 45.82000 |
|---|
| LogP | 2.89930 |
|---|
| Vapour Pressure | 0.00131mmHg at 25°C |
|---|
| Index of Refraction | 1.562 |
|---|
| InChIKey | KYJGYIQRMAGKBT-UHFFFAOYSA-N |
|---|
| SMILES | O=[N+]([O-])c1ccc(CCCl)cc1 |
|---|
Synonyms
| 4-nitrophenethyl chloride |
| 4-nitrophenylethyl bromide |
| 4-Nitro-phenaethylchlorid |
