Introduction：Basic information about CAS 42087-82-1|Benzoic acid,2,6-dinitro-, methyl ester, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Benzoic acid,2,6-dinitro-, methyl ester |
|---|
| CAS Number | 42087-82-1 | Molecular Weight | 226.14300 |
|---|
| Density | 1.497g/cm3 | Boiling Point | 323ºC at 760 mmHg |
|---|
| Molecular Formula | C8H6N2O6 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 151.5ºC |
|---|
Names
| Name | methyl 2,6-dinitrobenzoate |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.497g/cm3 |
|---|
| Boiling Point | 323ºC at 760 mmHg |
|---|
| Molecular Formula | C8H6N2O6 |
|---|
| Molecular Weight | 226.14300 |
|---|
| Flash Point | 151.5ºC |
|---|
| Exact Mass | 226.02300 |
|---|
| PSA | 117.94000 |
|---|
| LogP | 2.33600 |
|---|
| Index of Refraction | 1.592 |
|---|
| InChIKey | YZRFTJSIVVNRMI-UHFFFAOYSA-N |
|---|
| SMILES | COC(=O)c1c([N+](=O)[O-])cccc1[N+](=O)[O-] |
|---|
Synonyms
| 2,6-Dinitrobenzoesaeuremethylester |
| Methyl-2,6-dinitrobenzoat |
| 2,6-Di-nitro-benzoesaure-methylester |
| 2,6-dinitro-benzoic acid methyl ester |
