Introduction:Basic information about CAS 23094-96-4|3-Bromo-4-methoxybenzenesulfonyl chloride, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 3-Bromo-4-methoxybenzenesulfonyl chloride |
|---|
| CAS Number | 23094-96-4 | Molecular Weight | 285.543 |
|---|
| Density | 1.7±0.1 g/cm3 | Boiling Point | 366.0±27.0 °C at 760 mmHg |
|---|
| Molecular Formula | C7H6BrClO3S | Melting Point | / |
|---|
| MSDS | USA | Flash Point | 175.1±23.7 °C |
|---|
| Symbol | GHS05, GHS07 | Signal Word | Danger |
|---|
Names
| Name | 3-Bromo-4-methoxybenzenesulfonyl chloride |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.7±0.1 g/cm3 |
|---|
| Boiling Point | 366.0±27.0 °C at 760 mmHg |
|---|
| Molecular Formula | C7H6BrClO3S |
|---|
| Molecular Weight | 285.543 |
|---|
| Flash Point | 175.1±23.7 °C |
|---|
| Exact Mass | 283.890961 |
|---|
| PSA | 51.75000 |
|---|
| LogP | 3.45 |
|---|
| Vapour Pressure | 0.0±0.8 mmHg at 25°C |
|---|
| Index of Refraction | 1.569 |
|---|
| InChIKey | LTVLATJRJIBHDR-UHFFFAOYSA-N |
|---|
| SMILES | COc1ccc(S(=O)(=O)Cl)cc1Br |
|---|
| Storage condition | 2-8°C |
|---|
Safety Information
| Symbol | GHS05, GHS07 |
|---|
| Signal Word | Danger |
|---|
| Hazard Statements | H302-H314 |
|---|
| Precautionary Statements | P280-P305 + P351 + P338-P310 |
|---|
| RIDADR | UN 3261 8 / PGII |
|---|
| HS Code | 2909309090 |
|---|
Customs
| HS Code | 2909309090 |
|---|
| Summary | 2909309090 other aromatic ethers and their halogenated, sulphonated, nitrated or nitrosated derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:5.5% General tariff:30.0% |
|---|
Synonyms
| 3-Bromo-4-methoxy-benzenesulfonyl chloride |
| 3-bromo-4-methoxyphenylsulfonyl chloride |
| Benzenesulfonyl chloride, 3-bromo-4-methoxy- |
| 3-Brom-4-methoxy-benzolsulfonsaeurechlorid |
| 3-Bromo-4-methoxybenzenesulfonyl chloride |
| 5-bromo-4-methoxyphenylsulfonyl chloride |
| (3-bromo-4-methoxyphenyl)chlorosulfone |