Introduction：Basic information about CAS 100393-41-7|3-Amino-3-(naphthalen-1-yl)propanoic acid, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 3-Amino-3-(naphthalen-1-yl)propanoic acid |
|---|
| CAS Number | 100393-41-7 | Molecular Weight | 215.24800 |
|---|
| Density | 1.252g/cm3 | Boiling Point | 412.3ºC at 760mmHg |
|---|
| Molecular Formula | C13H13NO2 | Melting Point | 217-219ºC |
|---|
| MSDS | / | Flash Point | 203.2ºC |
|---|
Names
| Name | 3-amino-3-naphthalen-1-ylpropanoic acid |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.252g/cm3 |
|---|
| Boiling Point | 412.3ºC at 760mmHg |
|---|
| Melting Point | 217-219ºC |
|---|
| Molecular Formula | C13H13NO2 |
|---|
| Molecular Weight | 215.24800 |
|---|
| Flash Point | 203.2ºC |
|---|
| Exact Mass | 215.09500 |
|---|
| PSA | 63.32000 |
|---|
| LogP | 3.01460 |
|---|
| Vapour Pressure | 1.54E-07mmHg at 25°C |
|---|
| Index of Refraction | 1.658 |
|---|
| InChIKey | BIOQBKBTOAMMDG-UHFFFAOYSA-N |
|---|
| SMILES | NC(CC(=O)O)c1cccc2ccccc12 |
|---|
Safety Information
Customs
| HS Code | 2922499990 |
|---|
| Summary | HS:2922499990 other amino-acids, other than those containing more than one kind of oxygen function, and their esters; salts thereof VAT:17.0% Tax rebate rate:9.0% Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward) MFN tariff:6.5% General tariff:30.0% |
|---|
Synonyms
| 1-Naphthalenepropanoicacid,b-amino |
| 3-amino-3-(naphthalen-1-yl)propanoic acid |
| 3-amino-3-(1-naphthyl)propanoic acid |
| 3-Amino-3-[1]naphthyl-propionsaeure |
| 3-amino-3-naphthylpropanoic acid |
| 3-amino-3-(1-naphthyl)propionic acid |
| 3-Amino-3-naphthalen-1-yl-propionic acid |
| aminonaphthylpropanoicacid |
| rac-3-amino-3-(1-naphthyl)propanoic acid |
