CAS 72914-19-3|4,4'-Di-tert-butyl-2,2'-bipyridine
Introduction：Basic information about CAS 72914-19-3|4,4'-Di-tert-butyl-2,2'-bipyridine, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 4,4'-Di-tert-butyl-2,2'-bipyridine | ||
|---|---|---|---|
| CAS Number | 72914-19-3 | Molecular Weight | 268.397 |
| Density | 1.0±0.1 g/cm3 | Boiling Point | 395.4±42.0 °C at 760 mmHg |
| Molecular Formula | C18H24N2 | Melting Point | 159-161ºC(lit.) |
| MSDS | ChineseUSA | Flash Point | 150.2±19.5 °C |
| Symbol | GHS07 | Signal Word | Warning |
Names
| Name | 4,4'-Di-tert-butyl-2,2'-bipyridine |
|---|---|
| Synonym | More Synonyms |
Chemical & Physical Properties
| Density | 1.0±0.1 g/cm3 |
|---|---|
| Boiling Point | 395.4±42.0 °C at 760 mmHg |
| Melting Point | 159-161ºC(lit.) |
| Molecular Formula | C18H24N2 |
| Molecular Weight | 268.397 |
| Flash Point | 150.2±19.5 °C |
| Exact Mass | 268.193939 |
| PSA | 25.78000 |
| LogP | 4.66 |
| Appearance of Characters | crystal | white |
| Vapour Pressure | 0.0±0.9 mmHg at 25°C |
| Index of Refraction | 1.523 |
| InChIKey | TXNLQUKVUJITMX-UHFFFAOYSA-N |
| SMILES | CC(C)(C)c1ccnc(-c2cc(C(C)(C)C)ccn2)c1 |
| Stability | hygroscopic |
Safety Information
| Symbol | GHS07 |
|---|---|
| Signal Word | Warning |
| Hazard Statements | H315-H319-H335 |
| Precautionary Statements | P261-P305 + P351 + P338 |
| Personal Protective Equipment | dust mask type N95 (US);Eyeshields;Gloves |
| Hazard Codes | Xi: Irritant; |
| Risk Phrases | R36/37/38 |
| Safety Phrases | 26-36 |
| RIDADR | NONH for all modes of transport |
| WGK Germany | 3 |
| HS Code | 2933399090 |
Customs
| HS Code | 2933399090 |
|---|---|
| Summary | 2933399090. other compounds containing an unfused pyridine ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
Articles2
More Articles| Phenanthrene synthesis by iron-catalyzed [4+2] benzannulation between alkyne and biaryl or 2-alkenylphenyl Grignard reagent. J. Am. Chem. Soc. 133(17) , 6557-9, (2011) The [4+2] benzannulation reaction of internal or terminal alkynes with 2-biaryl, 2-heteroarylphenyl, or 2-alkenylphenyl Grignard reagents in the presence of Fe(acac)(3), 4,4'-di-tert-butyl-2,2'-bipyri... | |
| Iridium(III) silyl alkyl and iridacyclic compounds supported by 4,4'-di-tert-butyl-2,2'-bipyridyl. Chemistry 12(36) , 9323-35, (2006) Treatment of IrCl(3)x H(2)O with one equivalent of 4,4'-di-tert-butyl-2,2'-bipyridyl (dtbpy) in N,N-dimethylformamide (dmf) afforded [IrCl(3)(dmf)(dtbpy)] (1). Alkylation of 1 with Me(3)SiCH(2)MgCl re... |
Synonyms
| 4,4'-di-tBu-2,2'-bipyridine |
| 4,4'-Di-O-tert-butyl-2,2'-bypyridine |
| 4,4'-Bis(tert-butyl)-2,2'-bipyridine |
| 4,4'-di-tert-butyl-2,2'-dipyridyl |
| 4,4'-Di-tert-butyl-[2,2']bipyridinyl |
| BBBPY |
| 4,4'-di-tert-butyl-bpy |
| 4,4'-Bis(t-butyl)-2,2'-bipyridine |
| 4,4'-tBu2bpy |
| 4,4'-Di-tert-butyl-2,2'-bipyridine |
| 4 4'-DI-TERT-BUTYL-2 2'-DIPYRIDYL |
| 4,4'-dtbipy |
| 4,4'-Bis(2-methyl-2-propanyl)-2,2'-bipyridine |
| 4,4'-Di-t-butyl-2,2'-bipyridyl |
| MFCD01863731 |
| 4,4′-di-tert-butyl-2,2′bipyridyl |
| 2,2'-Bipyridine, 4,4'-bis(1,1-dimethylethyl)- |
| 4,4'-DI-TERT-BUTYL-2,2'-BYPYRIDINE |
| 4,4'-Di-tert-butyl-2,2'-bipyridyl |
| 2,2'-Bipyridine,4,4'-bis(1,1-dimethylethyl)- |
