CAS 218600-50-1|METHYL 3,12-DIOXOOLEAN-9(11)-EN-28-OATE
Introduction:Basic information about CAS 218600-50-1|METHYL 3,12-DIOXOOLEAN-9(11)-EN-28-OATE, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | METHYL 3,12-DIOXOOLEAN-9(11)-EN-28-OATE | ||
|---|---|---|---|
| CAS Number | 218600-50-1 | Molecular Weight | 482.694 |
| Density | 1.1±0.1 g/cm3 | Boiling Point | 557.1±50.0 °C at 760 mmHg |
| Molecular Formula | C31H46O4 | Melting Point | / |
| MSDS | / | Flash Point | 232.7±30.2 °C |
Names
| Name | methyl (4aS,6aR,6bS,12aS,14aR,14bR)-2,2,6a,6b,9,9,12a-heptamethyl-10,14-dioxo-1,3,4,5,6,7,8,8a,11,12,14a,14b-dodecahydropicene-4a-carboxylate |
|---|---|
| Synonym | More Synonyms |
Chemical & Physical Properties
| Density | 1.1±0.1 g/cm3 |
|---|---|
| Boiling Point | 557.1±50.0 °C at 760 mmHg |
| Molecular Formula | C31H46O4 |
| Molecular Weight | 482.694 |
| Flash Point | 232.7±30.2 °C |
| Exact Mass | 482.339600 |
| PSA | 60.44000 |
| LogP | 6.82 |
| Vapour Pressure | 0.0±1.5 mmHg at 25°C |
| Index of Refraction | 1.542 |
| InChIKey | ZSKIWSWEZHHVGY-UHFFFAOYSA-N |
| SMILES | COC(=O)C12CCC(C)(C)CC1C1C(=O)C=C3C4(C)CCC(=O)C(C)(C)C4CCC3(C)C1(C)CC2 |
Synonyms
| Methyl 3,12-dioxoolean-9(11)-en-28-oate |
| Olean-9(11)-en-28-oic acid, 3,12-dioxo-, methyl ester |
| (4aS,6aR,6bS,12aS,14aR,14bR)-methyl-2,2,6a,6b,9,9,12a-heptamethyl-10,14-dioxo-1,2,3,4,4a,5,6,6a,6b,7,8,8a,9,10,11,12,12a,14,14a,14b-icosahydropicene-4a-carboxylate |
| Olean-9(11)-en-28-oic acid, 3,12-dioxo-, methyl ester, (5ξ,18α)- |
| Olean-9(11)-en-28-oic acid,3,12-dioxo-,methyl ester |
| 2,2,6a,6b,9,9,12a-Heptamethyl-10,14-dioxo-1,3,4,5,6,6a,6b,7,8,8a,9,10,11,12,12a,14,14a,14b-octadecahydro-2H-picene-4a-carboxylic acid methyl ester |
| Methyl (5ξ,18α)-3,12-dioxoolean-9(11)-en-28-oate |
