Introduction：Basic information about CAS 58879-34-8|(S)-(+)-Dihydro-5-(p tolylsulfonyloxymethyl)-2(3H)-fu ranone, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | (S)-(+)-Dihydro-5-(p tolylsulfonyloxymethyl)-2(3H)-fu ranone |
|---|
| CAS Number | 58879-34-8 | Molecular Weight | 270.30200 |
|---|
| Density | 1.311g/cm3 | Boiling Point | 476.5ºC at 760 mmHg |
|---|
| Molecular Formula | C12H14O5S | Melting Point | 86-88ºC |
|---|
| MSDS | ChineseUSA | Flash Point | 242ºC |
|---|
| Symbol |
GHS07 | Signal Word | Warning |
|---|
Names
| Name | (S)-(5-Oxotetrahydrofuran-2-yl)methyl 4-methylbenzenesulfonate |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.311g/cm3 |
|---|
| Boiling Point | 476.5ºC at 760 mmHg |
|---|
| Melting Point | 86-88ºC |
|---|
| Molecular Formula | C12H14O5S |
|---|
| Molecular Weight | 270.30200 |
|---|
| Flash Point | 242ºC |
|---|
| Exact Mass | 270.05600 |
|---|
| PSA | 78.05000 |
|---|
| LogP | 2.48670 |
|---|
| Index of Refraction | 1.542 |
|---|
| InChIKey | MGAXYKDBRBNWKT-JTQLQIEISA-N |
|---|
| SMILES | Cc1ccc(S(=O)(=O)OCC2CCC(=O)O2)cc1 |
|---|
Safety Information
| Symbol |
GHS07 |
|---|
| Signal Word | Warning |
|---|
| Hazard Statements | H315-H319-H335 |
|---|
| Precautionary Statements | P261-P305 + P351 + P338 |
|---|
| Personal Protective Equipment | dust mask type N95 (US);Eyeshields;Gloves |
|---|
| Hazard Codes | Xi |
|---|
| Risk Phrases | R36/37/38 |
|---|
| Safety Phrases | S26-S36 |
|---|
| RIDADR | NONH for all modes of transport |
|---|
| HS Code | 2932190090 |
|---|
Customs
| HS Code | 2932190090 |
|---|
| Summary | 2932190090 other compounds containing an unfused furan ring (whether or not hydrogenated) in the structure VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:20.0% |
|---|
Synonyms
| (S)-(+)-Dihydro-5-(p-tolysulfonyioxymethyl)-2-(3H)-furanone |
| (S)-(+)-Toluenesulfonylmethyl)--butyrolactone |
| (S)-(+)-DIHYDRO-5-(P-TOLYLSULFONYLOXYMETHYL)-2(3H)-FURANONE |
| toluene-4-sulfonic acid (S)-5-oxo-tetrahydro-furan-2-ylmethyl ester |
| (5S)-(+)-dihydro-5-(p-tolylsulfonyloxymethyl)-2(3H)-furanone |
| (S)-(+)-5-(4-Toluolsulfonyloxy)-methyl-4,5-dihydro-2(3H)-furanon |
| (S)-(+)-Dihydro-5-(4-tolylsulfonyloxymethyl)-2(3H)-furanone |
| 5-O-p-toluenesulfonyl-2,3-dideoxy-D-glycero-pentono-1,4-lactone |
| (S)-(+)-g-Toluenesulfonylmethyl-g-butyrolactone. |
| (2S)-toluene-4-sulfonic acid 5-oxo-tetrahydro-furan-2-ylmethyl ester |
| [(2S)-5-oxotetrahydrofuran-2-yl]methyl 4-methylbenzenesulfonate |
| MFCD00082548 |
