Introduction:Basic information about CAS 81529-60-4|4-(2,4,6-TRIMETHYL-PHENYL)-THIAZOL-2-YLAMINE, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 4-(2,4,6-TRIMETHYL-PHENYL)-THIAZOL-2-YLAMINE |
|---|
| CAS Number | 81529-60-4 | Molecular Weight | 218.31800 |
|---|
| Density | 1.158g/cm3 | Boiling Point | 351.4ºC at 760 mmHg |
|---|
| Molecular Formula | C12H14N2S | Melting Point | / |
|---|
| MSDS | / | Flash Point | 166.3ºC |
|---|
Names
| Name | 4-(2,4,6-trimethylphenyl)-1,3-thiazol-2-amine |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.158g/cm3 |
|---|
| Boiling Point | 351.4ºC at 760 mmHg |
|---|
| Molecular Formula | C12H14N2S |
|---|
| Molecular Weight | 218.31800 |
|---|
| Flash Point | 166.3ºC |
|---|
| Exact Mass | 218.08800 |
|---|
| PSA | 67.88000 |
|---|
| LogP | 3.24760 |
|---|
| Index of Refraction | 1.617 |
|---|
| InChIKey | QKYORNXSXAOYPV-UHFFFAOYSA-N |
|---|
| SMILES | Cc1cc(C)c(-c2csc(N)n2)c(C)c1 |
|---|
Safety Information
Customs
| HS Code | 2934100090 |
|---|
| Summary | 2934100090 other compounds containing an unfused thiazole ring (whether or not hydrogenated) in the structure VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:20.0% |
|---|
Synonyms
| 4-(2,4,6-trimethylphenyl)-2-aminothiazole |
| 4-Mesityl-2-thiazolamine |
| 4-Mesityl-thiazol-2-ylamin |
| 4-(2,4,6-trimethylphenyl)thiazol-2-ylamine |
| 4-mesityl-thiazol-2-ylamine |
| 2-amino-4-(2,4,6-trimethylphenyl)thiazole |
| F0017-0517 |
| 4-mesitylthiazol-2-amine |
| 4-Mesityl-1,3-thiazol-2-amine |