Introduction：Basic information about CAS 882847-19-0|Fmoc-Gabapentin, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Fmoc-Gabapentin |
|---|
| CAS Number | 882847-19-0 | Molecular Weight | 393.475 |
|---|
| Density | 1.2±0.1 g/cm3 | Boiling Point | 612.8±28.0 °C at 760 mmHg |
|---|
| Molecular Formula | C24H27NO4 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 324.4±24.0 °C |
|---|
Names
| Name | 2-[1-[(9H-fluoren-9-ylmethoxycarbonylamino)methyl]cyclohexyl]acetic acid |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.2±0.1 g/cm3 |
|---|
| Boiling Point | 612.8±28.0 °C at 760 mmHg |
|---|
| Molecular Formula | C24H27NO4 |
|---|
| Molecular Weight | 393.475 |
|---|
| Flash Point | 324.4±24.0 °C |
|---|
| Exact Mass | 393.194000 |
|---|
| PSA | 75.63000 |
|---|
| LogP | 5.42 |
|---|
| Vapour Pressure | 0.0±1.9 mmHg at 25°C |
|---|
| Index of Refraction | 1.583 |
|---|
| InChIKey | JQJOWILVGOJWJF-UHFFFAOYSA-N |
|---|
| SMILES | O=C(O)CC1(CNC(=O)OCC2c3ccccc3-c3ccccc32)CCCCC1 |
|---|
Synonyms
| [1-({[(9H-Fluoren-9-ylmethoxy)carbonyl]amino}methyl)cyclohexyl]acetic acid |
| Cyclohexaneacetic acid, 1-[[[(9H-fluoren-9-ylmethoxy)carbonyl]amino]methyl]- |
| [1-((Fmoc-amino)methyl)cyclohexyl]acetic acid |
| Fmoc-gabapentin |
| [1-[(9h-fluoren-9-ylmethoxycarbonylamino)-methyl]-cyclohexyl]-acetic acid |
