Introduction:Basic information about CAS 37737-62-5|2,2'-[1,2-Phenylenebis(oxy)]bis(1,3,2-benzodioxaborole), including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 2,2'-[1,2-Phenylenebis(oxy)]bis(1,3,2-benzodioxaborole) |
|---|
| CAS Number | 37737-62-5 | Molecular Weight | 345.90600 |
|---|
| Density | / | Boiling Point | 170ºC.03 mm Hg(lit.) |
|---|
| Molecular Formula | C18H12B2O6 | Melting Point | 102-109ºC(lit.) |
|---|
| MSDS | / | Flash Point | / |
|---|
Names
| Name | 2,2'-[1,2-Phenylenebis(oxy)]bis(1,3,2-benzodioxaborole) |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Boiling Point | 170ºC.03 mm Hg(lit.) |
|---|
| Melting Point | 102-109ºC(lit.) |
|---|
| Molecular Formula | C18H12B2O6 |
|---|
| Molecular Weight | 345.90600 |
|---|
| Exact Mass | 346.08200 |
|---|
| PSA | 55.38000 |
|---|
| LogP | 3.35680 |
|---|
| InChIKey | WKEXSQGNCGXAHZ-UHFFFAOYSA-N |
|---|
| SMILES | c1ccc(OB2Oc3ccccc3O2)c(OB2Oc3ccccc3O2)c1 |
|---|
Safety Information
| Safety Phrases | 22-24/25 |
|---|
| WGK Germany | 3 |
|---|
| HS Code | 2909309090 |
|---|
Customs
| HS Code | 2909309090 |
|---|
| Summary | 2909309090 other aromatic ethers and their halogenated, sulphonated, nitrated or nitrosated derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:5.5% General tariff:30.0% |
|---|
Synonyms
| 2,2'-o-phenylenedioxy-bis-benzo[1,3,2]dioxaborole |
| tris(o-phenylenedioxa)bisborate |
| o-Phenylen-di-isobuttersaeure-dimethylester |
| phenylene-1,2-dioxo-bis(1,3,2-dioxaborolane) |
| bis(benzo-1,3,2-dioxaboranyl)pyrocatecholate |
| tris(catecholato)diboron |
| Dimethyl-o-phenylen-diisobutyrat |
| o-Phenylendioxy-bis(1,3,2-benzodioxaborol) |
| MFCD01330904 |
| methyl 2-[2-(2-methoxycarbonylpropan-2-yl)phenyl]-2-methyl-propanoate |
| 1,2-bis-benzo[1,3,2]dioxaborol-2-yloxy-benzene |