Introduction：Basic information about CAS 143701-75-1|3-Cyclopropyl-2-[2-(methylsulfonyl)-4-(trifluoromethyl)benzoyl]-3 -oxopropane, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 3-Cyclopropyl-2-[2-(methylsulfonyl)-4-(trifluoromethyl)benzoyl]-3 -oxopropanenitrile |
|---|
| CAS Number | 143701-75-1 | Molecular Weight | 359.32000 |
|---|
| Density | / | Boiling Point | 527.796ºC at 760 mmHg |
|---|
| Molecular Formula | C15H12F3NO4S | Melting Point | / |
|---|
| MSDS | / | Flash Point | 273.001ºC |
|---|
Names
| Name | 3-Cyclopropyl-2-[2-(methylsulfonyl)-4-(trifluoromethyl)benzoyl]-3 -oxopropanenitrile |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Boiling Point | 527.796ºC at 760 mmHg |
|---|
| Molecular Formula | C15H12F3NO4S |
|---|
| Molecular Weight | 359.32000 |
|---|
| Flash Point | 273.001ºC |
|---|
| Exact Mass | 359.04400 |
|---|
| PSA | 100.45000 |
|---|
| LogP | 3.49128 |
|---|
| Vapour Pressure | 0mmHg at 25°C |
|---|
| Index of Refraction | 1.528 |
|---|
| InChIKey | ZTTKDUXKVPEXCG-UHFFFAOYSA-N |
|---|
| SMILES | CS(=O)(=O)c1cc(C(F)(F)F)ccc1C(=O)C(C#N)C(=O)C1CC1 |
|---|
Synonyms
| 2-cyano-1-[2-methylsulfonyl-4-(trifluoromethyl)phenyl]-3-cyclopropylpropan-1,3-dione |
| Diketonitrile-isoxaflutole |
| 2-cyano-3-cyclopropyl-1-(2-methylsulphonyl-4-trifluoromethylphenyl)propan-1,3-dione |
| 2-cyano-3-cyclopropyl-1-(2-methanesulfonyl-4-trifluoromethylphenyl)propane-1,3-dione |
