Introduction:Basic information about CAS 23256-23-7|Sulfatroxazole, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Sulfatroxazole |
|---|
| CAS Number | 23256-23-7 | Molecular Weight | 267.30400 |
|---|
| Density | 1.411g/cm3 | Boiling Point | 484.9ºC at 760mmHg |
|---|
| Molecular Formula | C11H13N3O3S | Melting Point | / |
|---|
| MSDS | / | Flash Point | 247.1ºC |
|---|
Names
| Name | 4-Amino-N-(4,5-dimethyl-1,2-oxazol-3-yl)benzenesulfonamide |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.411g/cm3 |
|---|
| Boiling Point | 484.9ºC at 760mmHg |
|---|
| Molecular Formula | C11H13N3O3S |
|---|
| Molecular Weight | 267.30400 |
|---|
| Flash Point | 247.1ºC |
|---|
| Exact Mass | 267.06800 |
|---|
| PSA | 106.60000 |
|---|
| LogP | 3.40940 |
|---|
| Vapour Pressure | 1.47E-09mmHg at 25°C |
|---|
| Index of Refraction | 1.626 |
|---|
| InChIKey | DAUFGBIKKGOPJA-UHFFFAOYSA-N |
|---|
| SMILES | Cc1onc(NS(=O)(=O)c2ccc(N)cc2)c1C |
|---|
| Storage condition | 2-8°C |
|---|
Safety Information
Customs
| HS Code | 2935009090 |
|---|
| Summary | 2935009090 other sulphonamides VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:35.0% |
|---|
Synonyms
| Sulfatroxazol |
| 4-amino-N-(4,5-dimethyl-isoxazol-3-yl)-benzenesulfonamide |
| Isosulfafurazole |
| sulfatroxazole |
| N1-(3,4-dimethylisoxazole-5-yl)sulfanilamide |
| Sulfatroxazolum |
| UNII-ZXC0PT8FFS |
| Sulfatroxazolum [INN-Latin] |
| 3-Sulfanilamido-4,5-dimethylisoxazol |
| Sulfisoxazol |
| Sulfatroxazol [INN-Spanish] |