Introduction：Basic information about CAS 855300-09-3|N-Ethyl-N-methylcarbamic acid 3-acetylphenyl ester, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | N-Ethyl-N-methylcarbamic acid 3-acetylphenyl ester |
|---|
| CAS Number | 855300-09-3 | Molecular Weight | 221.25200 |
|---|
| Density | 1.112 | Boiling Point | 337 ºC |
|---|
| Molecular Formula | C12H15NO3 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 158 ºC |
|---|
Names
| Name | (3-acetylphenyl) N-ethyl-N-methylcarbamate |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.112 |
|---|
| Boiling Point | 337 ºC |
|---|
| Molecular Formula | C12H15NO3 |
|---|
| Molecular Weight | 221.25200 |
|---|
| Flash Point | 158 ºC |
|---|
| Exact Mass | 221.10500 |
|---|
| PSA | 46.61000 |
|---|
| LogP | 2.33970 |
|---|
| InChIKey | ABNQSLSOFYAGHU-UHFFFAOYSA-N |
|---|
| SMILES | CCN(C)C(=O)Oc1cccc(C(C)=O)c1 |
|---|
| Storage condition | 2-8°C |
|---|
Safety Information
| Hazard Codes | Xi |
|---|
| HS Code | 2924299090 |
|---|
Customs
| HS Code | 2924299090 |
|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
|---|
Synonyms
| RA02 |
| N-ethyl-N-methylcarbamic acid 3-acetylphenyl ester |
| 3-acetylphenyl N-ethyl-N-methylcarbamate |
| Y4293 |
| UNII-502LM1L59E |
| Rivastigmine Impurity 3 |
