Introduction：Basic information about CAS 328-79-0|3-Methoxy-5-nitrobenzotrifluoride, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 3-Methoxy-5-nitrobenzotrifluoride |
|---|
| CAS Number | 328-79-0 | Molecular Weight | 221.133 |
|---|
| Density | 1.4±0.1 g/cm3 | Boiling Point | 246.9±40.0 °C at 760 mmHg |
|---|
| Molecular Formula | C8H6F3NO3 | Melting Point | 36-38 °C(lit.) |
|---|
| MSDS | / | Flash Point | 103.1±27.3 °C |
|---|
| Symbol |
GHS05 | Signal Word | Danger |
|---|
Names
| Name | 1-methoxy-3-nitro-5-(trifluoromethyl)benzene |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.4±0.1 g/cm3 |
|---|
| Boiling Point | 246.9±40.0 °C at 760 mmHg |
|---|
| Melting Point | 36-38 °C(lit.) |
|---|
| Molecular Formula | C8H6F3NO3 |
|---|
| Molecular Weight | 221.133 |
|---|
| Flash Point | 103.1±27.3 °C |
|---|
| Exact Mass | 221.029984 |
|---|
| PSA | 55.05000 |
|---|
| LogP | 3.33 |
|---|
| Vapour Pressure | 0.0±0.5 mmHg at 25°C |
|---|
| Index of Refraction | 1.472 |
|---|
| InChIKey | NCPVPJVRLLHBEL-UHFFFAOYSA-N |
|---|
| SMILES | COc1cc([N+](=O)[O-])cc(C(F)(F)F)c1 |
|---|
Safety Information
| Symbol |
GHS05 |
|---|
| Signal Word | Danger |
|---|
| Hazard Statements | H314 |
|---|
| Precautionary Statements | P280-P305 + P351 + P338-P310 |
|---|
| Personal Protective Equipment | Eyeshields;Faceshields;full-face particle respirator type N100 (US);Gloves;respirator cartridge type N100 (US);type P1 (EN143) respirator filter;type P3 (EN 143) respirator cartridges |
|---|
| Hazard Codes | C: Corrosive; |
|---|
| Risk Phrases | R34 |
|---|
| Safety Phrases | S26-S27-S28-S36/37/39-S45 |
|---|
| RIDADR | UN 1759 8/PG 2 |
|---|
| WGK Germany | 3 |
|---|
| Packaging Group | III |
|---|
| Hazard Class | 8 |
|---|
| HS Code | 2909309090 |
|---|
Customs
| HS Code | 2909309090 |
|---|
| Summary | 2909309090 other aromatic ethers and their halogenated, sulphonated, nitrated or nitrosated derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:5.5% General tariff:30.0% |
|---|
Synonyms
| 3-methoxy-3-nitro-5-(trifluoromethyl)benzene |
| 1-methoxy-3-nitro-5-trifluoromethyl-benzene |
| 1-Methoxy-3-nitro-5-(trifluoromethyl)benzene |
| 3-Methoxy-5-nitrobenzotrifluoride |
| 3-nitro-5-trifluoromethyl-anisole |
| MFCD00010446 |
| Methyl 3-nitro-5-(trifluoromethyl)phenyl ether |
| 5-methoxy-1-nitro-3-(trifluoromethyl)benzene |
| Benzene, 1-methoxy-3-nitro-5-(trifluoromethyl)- |
| 3-Nitro-5-trifluormethyl-anisol |
| 5-methoxy-3-nitrobenzotrifluoride |
