Introduction:Basic information about CAS 10481-92-2|Amurensine, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Amurensine |
|---|
| CAS Number | 10481-92-2 | Molecular Weight | 325.35800 |
|---|
| Density | 1.328g/cm3 | Boiling Point | 458.8ºC at 760mmHg |
|---|
| Molecular Formula | C19H19NO4 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 231.3ºC |
|---|
Names
Chemical & Physical Properties
| Density | 1.328g/cm3 |
|---|
| Boiling Point | 458.8ºC at 760mmHg |
|---|
| Molecular Formula | C19H19NO4 |
|---|
| Molecular Weight | 325.35800 |
|---|
| Flash Point | 231.3ºC |
|---|
| Exact Mass | 325.13100 |
|---|
| PSA | 51.16000 |
|---|
| LogP | 2.74190 |
|---|
| Vapour Pressure | 4.87E-09mmHg at 25°C |
|---|
| Index of Refraction | 1.643 |
|---|
| InChIKey | BXWVSGUITWLTOD-CABCVRRESA-N |
|---|
| SMILES | COc1cc2c(cc1O)C1CN(C)C(C2)c2cc3c(cc21)OCO3 |
|---|