Introduction:Basic information about CAS 10486-14-3|rhodinyl phenyl acetate, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | rhodinyl phenyl acetate |
|---|
| CAS Number | 10486-14-3 | Molecular Weight | 274.39800 |
|---|
| Density | 0.959g/cm3 | Boiling Point | 372.4ºC at 760mmHg |
|---|
| Molecular Formula | C18H26O2 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 120ºC |
|---|
Names
| Name | 3,7-dimethyloct-7-enyl 2-phenylacetate |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 0.959g/cm3 |
|---|
| Boiling Point | 372.4ºC at 760mmHg |
|---|
| Molecular Formula | C18H26O2 |
|---|
| Molecular Weight | 274.39800 |
|---|
| Flash Point | 120ºC |
|---|
| Exact Mass | 274.19300 |
|---|
| PSA | 26.30000 |
|---|
| LogP | 4.54490 |
|---|
| Vapour Pressure | 9.67E-06mmHg at 25°C |
|---|
| Index of Refraction | 1.495 |
|---|
| InChIKey | SKZDJVXLRPCFQC-INIZCTEOSA-N |
|---|
| SMILES | C=C(C)CCCC(C)CCOC(=O)Cc1ccccc1 |
|---|
Synonyms
| Phenyl acetate de rhodinyle |
| 3,7-Dimethyl-7-octenyl phenylacetate |
| FEMA No. 2985 |
| Rhodinyl phenylacetate |
| EINECS 234-003-5 |
| 3,7-Dimethyl-7-octen-1-yl phenylacetate |