Introduction：Basic information about CAS 74447-88-4|4,5-Dioxo-4,5-dihydro-1H-pyrrol[2,3-f]quinoline-2,7,9-tricarboxylic acid trime, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 4,5-Dioxo-4,5-dihydro-1H-pyrrol[2,3-f]quinoline-2,7,9-tricarboxylic acid trimethyl ester |
|---|
| CAS Number | 74447-88-4 | Molecular Weight | 372.28600 |
|---|
| Density | 1.523g/cm3 | Boiling Point | 652.7ºC at 760 mmHg |
|---|
| Molecular Formula | C17H12N2O8 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 348.5ºC |
|---|
Names
| Name | trimethyl 4,5-dioxo-1H-pyrrolo[2,3-f]quinoline-2,7,9-tricarboxylate |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.523g/cm3 |
|---|
| Boiling Point | 652.7ºC at 760 mmHg |
|---|
| Molecular Formula | C17H12N2O8 |
|---|
| Molecular Weight | 372.28600 |
|---|
| Flash Point | 348.5ºC |
|---|
| Exact Mass | 372.05900 |
|---|
| PSA | 141.72000 |
|---|
| LogP | 0.81550 |
|---|
| Index of Refraction | 1.626 |
|---|
| InChIKey | IYEWQFSKJDXIPI-UHFFFAOYSA-N |
|---|
| SMILES | COC(=O)c1cc(C(=O)OC)c2c(n1)C(=O)C(=O)c1cc(C(=O)OC)[nH]c1-2 |
|---|
Synonyms
| Methoxatin trimethyl ester |
| pyrroloquinolinequinone trimethyl ester |
| PQQ trimethyl ester |
| Coenzyme PQQ trimethyl ester |
