Introduction:Basic information about CAS 76-82-4|(4-amino-3-methyl-phenyl)-bis(4-aminophenyl)methanol, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | (4-amino-3-methyl-phenyl)-bis(4-aminophenyl)methanol |
|---|
| CAS Number | 76-82-4 | Molecular Weight | 319.40000 |
|---|
| Density | 1.26g/cm3 | Boiling Point | 597.7ºC at 760 mmHg |
|---|
| Molecular Formula | C20H21N3O | Melting Point | / |
|---|
| MSDS | / | Flash Point | 315.3ºC |
|---|
Names
| Name | (4-amino-3-methylphenyl)-bis(4-aminophenyl)methanol |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.26g/cm3 |
|---|
| Boiling Point | 597.7ºC at 760 mmHg |
|---|
| Molecular Formula | C20H21N3O |
|---|
| Molecular Weight | 319.40000 |
|---|
| Flash Point | 315.3ºC |
|---|
| Exact Mass | 319.16800 |
|---|
| PSA | 98.29000 |
|---|
| LogP | 4.76940 |
|---|
| Index of Refraction | 1.706 |
|---|
| InChIKey | OYHZNLZYIRSDHN-UHFFFAOYSA-N |
|---|
| SMILES | Cc1cc(C(O)(c2ccc(N)cc2)c2ccc(N)cc2)ccc1N |
|---|
Synonyms
| Fuchsin-Leukobase |
| Triamino-diphenyl-tolylcarbinol |
| C.I. Basic Violet 14,carbinol |
| 4.4'.4''-Triamino-3-methyl-triphenylcarbinol |