Introduction:Basic information about CAS 41573-36-8|4-[(2-chlorophenyl)-[4-(dimethylamino)phenyl]methyl]-N,N-dimethylaniline, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 4-[(2-chlorophenyl)-[4-(dimethylamino)phenyl]methyl]-N,N-dimethylaniline |
|---|
| CAS Number | 41573-36-8 | Molecular Weight | 364.91100 |
|---|
| Density | 1.138g/cm3 | Boiling Point | 496.1ºC at 760mmHg |
|---|
| Molecular Formula | C23H25ClN2 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 253.8ºC |
|---|
Names
| Name | 4-[(2-chlorophenyl)-[4-(dimethylamino)phenyl]methyl]-N,N-dimethylaniline |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.138g/cm3 |
|---|
| Boiling Point | 496.1ºC at 760mmHg |
|---|
| Molecular Formula | C23H25ClN2 |
|---|
| Molecular Weight | 364.91100 |
|---|
| Flash Point | 253.8ºC |
|---|
| Exact Mass | 364.17100 |
|---|
| PSA | 6.48000 |
|---|
| LogP | 5.65220 |
|---|
| Index of Refraction | 1.625 |
|---|
| InChIKey | JPPVTKZGOJUZKN-UHFFFAOYSA-N |
|---|
| SMILES | CN(C)c1ccc(C(c2ccc(N(C)C)cc2)c2ccccc2Cl)cc1 |
|---|
Safety Information
Customs
| HS Code | 2921590090 |
|---|
| Summary | 2921590090. other aromatic polyamines and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
|---|
Synonyms
| (2-chloro-phenyl)-bis-(4-dimethylamino-phenyl)-methane |
| Benzenamine,4,4'-(2-chlorobenzylidene)bis(N,N-dimethyl |
| 4,4'-(2-Chlorobenzylidene)bis(N,N-dimethyl-aniline) |
| (2-Chlor-phenyl)-bis-(4-dimethylamino-phenyl)-methan |
| 4,4'-[(2-chlorophenyl)methanediyl]bis(N,N-dimethylaniline) |
| EINECS 255-443-4 |
| 2''-Chlor-4.4'-bis-dimethylamino-triphenylmethan |
| 4',4"bis(dimethylamino)-2-chlorotriphenylmethane |
| 4,4'-((2-Chlorophenyl)methylene)bis(N,N-dimethylbenzenamine) |