Introduction：Basic information about CAS 29814-12-8|2(5H)-FURANONE, 3,4-DICHLORO-5-(1-METHYLETHOXY)-, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 2(5H)-FURANONE, 3,4-DICHLORO-5-(1-METHYLETHOXY)- |
|---|
| CAS Number | 29814-12-8 | Molecular Weight | 211.04300 |
|---|
| Density | 1.308g/cm3 | Boiling Point | 269.1ºC at 760mmHg |
|---|
| Molecular Formula | C7H8Cl2O3 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 112.7ºC |
|---|
Names
| Name | propan-2-yl 2,3-dichloro-4-oxobut-2-enoate |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.308g/cm3 |
|---|
| Boiling Point | 269.1ºC at 760mmHg |
|---|
| Molecular Formula | C7H8Cl2O3 |
|---|
| Molecular Weight | 211.04300 |
|---|
| Flash Point | 112.7ºC |
|---|
| Exact Mass | 209.98500 |
|---|
| PSA | 43.37000 |
|---|
| LogP | 1.82610 |
|---|
| Vapour Pressure | 0.00738mmHg at 25°C |
|---|
| Index of Refraction | 1.48 |
|---|
| InChIKey | YBSQZBGLKVFFSI-WAYWQWQTSA-N |
|---|
| SMILES | CC(C)OC(=O)C(Cl)=C(Cl)C=O |
|---|
Synonyms
| mucochloric acid isopropoxy ether |
| 3,4-dichloro-5-isopropoxy-5H-furan-2-one |
| 3,4-Dichlor-5-isopropoxy-5H-furan-2-on |
| 3,4-Dichloro-5-isopropoxy-2-furanone |
