Introduction：Basic information about CAS 50906-56-4|Arteannuin B, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Arteannuin B |
|---|
| CAS Number | 50906-56-4 | Molecular Weight | 248.318 |
|---|
| Density | 1.2±0.1 g/cm3 | Boiling Point | 398.7±35.0 °C at 760 mmHg |
|---|
| Molecular Formula | C15H20O3 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 168.5±20.5 °C |
|---|
Names
| Name | Arteannuin B |
|---|
| Synonym | More Synonyms |
|---|
Arteannuin B BiologicalActivity
| Description | Arteannuin B co-occurs with artemisinin, which is the potent antimalarial principle of the Chinese medicinal herb Artemisia annua (Asteraceae)[1]. |
|---|
| Related Catalog | Research Areas >>InfectionSignaling Pathways >>Others >>Others |
|---|
| References | [1]. Nair MS, et al. Bioconversion of arteannuin B to artemisinin. J Nat Prod. 1993 Sep;56(9):1559-66. |
|---|
Chemical & Physical Properties
| Density | 1.2±0.1 g/cm3 |
|---|
| Boiling Point | 398.7±35.0 °C at 760 mmHg |
|---|
| Molecular Formula | C15H20O3 |
|---|
| Molecular Weight | 248.318 |
|---|
| Flash Point | 168.5±20.5 °C |
|---|
| Exact Mass | 248.141251 |
|---|
| PSA | 38.83000 |
|---|
| LogP | 1.91 |
|---|
| Vapour Pressure | 0.0±0.9 mmHg at 25°C |
|---|
| Index of Refraction | 1.549 |
|---|
| InChIKey | QWQSMEDUZQDVLA-KPHNHPKPSA-N |
|---|
| SMILES | C=C1C(=O)OC23C1CCC(C)C2CCC1(C)OC13 |
|---|
Safety Information
Synonyms
| Quinghaosu II |
| Arsinous acid,dimethyl-,2-hydroxyethyl ester |
| (1aR,1bR,4aS,7R,7aS,9aR)-7,9a-Dimethyl-4-methylenedecahydro-3H-oxireno[7,8]naphtho[8a,1-b]furan-3-one |
| Arteannuin B |
| Arsinigsaeureglykolester |
| 3H-Oxireno[7,8]naphtho[8a,1-b]furan-3-one, decahydro-7,9a-dimethyl-4-methylene-, (1aR,1bR,4aS,7R,7aS,9aR)- |
| arteanniun L |
