Introduction:Basic information about CAS 10040-86-5|4-chlorobenzalhydantoin, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 4-chlorobenzalhydantoin |
|---|
| CAS Number | 10040-86-5 | Molecular Weight | 222.62800 |
|---|
| Density | 1.45g/cm3 | Boiling Point | / |
|---|
| Molecular Formula | C10H7ClN2O2 | Melting Point | / |
|---|
| MSDS | / | Flash Point | / |
|---|
Names
| Name | 4-chlorobenzalhydantoin |
|---|
Chemical & Physical Properties
| Density | 1.45g/cm3 |
|---|
| Molecular Formula | C10H7ClN2O2 |
|---|
| Molecular Weight | 222.62800 |
|---|
| Exact Mass | 222.02000 |
|---|
| PSA | 58.20000 |
|---|
| LogP | 2.17790 |
|---|
| Index of Refraction | 1.654 |
|---|
| InChIKey | NXSHAXRMBPQCIM-UHFFFAOYSA-N |
|---|
| SMILES | O=C1NC(=O)C(=Cc2ccc(Cl)cc2)N1 |
|---|