Introduction：Basic information about CAS 27469-53-0|almitrine, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | almitrine |
|---|
| CAS Number | 27469-53-0 | Molecular Weight | 477.55200 |
|---|
| Density | 1.262 g/cm3 | Boiling Point | 606.2ºC at 760 mmHg |
|---|
| Molecular Formula | C26H29F2N7 | Melting Point | 181° |
|---|
| MSDS | / | Flash Point | / |
|---|
Names
| Name | almitrine |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.262 g/cm3 |
|---|
| Boiling Point | 606.2ºC at 760 mmHg |
|---|
| Melting Point | 181° |
|---|
| Molecular Formula | C26H29F2N7 |
|---|
| Molecular Weight | 477.55200 |
|---|
| Exact Mass | 477.24500 |
|---|
| PSA | 69.21000 |
|---|
| LogP | 4.40610 |
|---|
| Vapour Pressure | 1.21E-14mmHg at 25°C |
|---|
| Index of Refraction | 1.633 |
|---|
| InChIKey | OBDOVFRMEYHSQB-UHFFFAOYSA-N |
|---|
| SMILES | C=CCNc1nc(NCC=C)nc(N2CCN(C(c3ccc(F)cc3)c3ccc(F)cc3)CC2)n1 |
|---|
Synonyms
| Almitrine bismesylate |
| ALMITRINE |
| Almitrin |
| Almitrina |
| Vectarion |
| Almitrinum |
| 6-[4-[bis(4-fluorophenyl)methyl]piperazin-1-yl]-2-N,4-N-bis(prop-2-enyl)-1,3,5-triazine-2,4-diamine |
