Introduction：Basic information about CAS 94593-08-5|1,3-Dimethoxy-1,1,3,3-tetraphenyldisiloxane, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 1,3-Dimethoxy-1,1,3,3-tetraphenyldisiloxane |
|---|
| CAS Number | 94593-08-5 | Molecular Weight | 442.654 |
|---|
| Density | 1.1±0.1 g/cm3 | Boiling Point | 457.5±18.0 °C at 760 mmHg |
|---|
| Molecular Formula | C26H26O3Si2 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 188.6±21.6 °C |
|---|
Names
| Name | 1,3-Dimethoxy-1,1,3,3-tetraphenyldisiloxane |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.1±0.1 g/cm3 |
|---|
| Boiling Point | 457.5±18.0 °C at 760 mmHg |
|---|
| Molecular Formula | C26H26O3Si2 |
|---|
| Molecular Weight | 442.654 |
|---|
| Flash Point | 188.6±21.6 °C |
|---|
| Exact Mass | 442.142059 |
|---|
| PSA | 27.69000 |
|---|
| LogP | 10.86 |
|---|
| Vapour Pressure | 0.0±1.1 mmHg at 25°C |
|---|
| Index of Refraction | 1.595 |
|---|
| InChIKey | CDHRQJOOOVAAFQ-UHFFFAOYSA-N |
|---|
| SMILES | CO[Si](O[Si](OC)(c1ccccc1)c1ccccc1)(c1ccccc1)c1ccccc1 |
|---|
Synonyms
| Benzene, 1,1',1'',1'''-(1,3-dimethoxy-1,3-disiloxanediylidene)tetrakis- |
| 1,3-Dimethoxy-1,1,3,3-tetraphenyldisiloxane |
| methoxy-[methoxy(diphenyl)silyl]oxy-diphenylsilane |
