Introduction:Basic information about CAS 1016-78-0|3-Chlorobenzophenone, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 3-Chlorobenzophenone |
|---|
| CAS Number | 1016-78-0 | Molecular Weight | 216.663 |
|---|
| Density | 1.2±0.1 g/cm3 | Boiling Point | 339.1±25.0 °C at 760 mmHg |
|---|
| Molecular Formula | C13H9ClO | Melting Point | 85-87 °C(lit.) |
|---|
| MSDS | / | Flash Point | 178.3±14.3 °C |
|---|
Names
| Name | (3-Chlorophenyl)(phenyl)methanone |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.2±0.1 g/cm3 |
|---|
| Boiling Point | 339.1±25.0 °C at 760 mmHg |
|---|
| Melting Point | 85-87 °C(lit.) |
|---|
| Molecular Formula | C13H9ClO |
|---|
| Molecular Weight | 216.663 |
|---|
| Flash Point | 178.3±14.3 °C |
|---|
| Exact Mass | 216.034195 |
|---|
| PSA | 17.07000 |
|---|
| LogP | 3.98 |
|---|
| Vapour Pressure | 0.0±0.7 mmHg at 25°C |
|---|
| Index of Refraction | 1.594 |
|---|
| InChIKey | CPLWKNRPZVNELG-UHFFFAOYSA-N |
|---|
| SMILES | O=C(c1ccccc1)c1cccc(Cl)c1 |
|---|
Safety Information
| Hazard Codes | Xn:Harmful; |
|---|
| Risk Phrases | R20/21/22;R36/37/38 |
|---|
| Safety Phrases | S26-S37/39-S36/37/39-S22 |
|---|
| WGK Germany | 3 |
|---|
| HS Code | 2914700090 |
|---|
Customs
| HS Code | 2914700090 |
|---|
| Summary | HS: 2914700090 halogenated, sulphonated, nitrated or nitrosated derivatives of ketones and quinones, whether or not with other oxygen function Tax rebate rate:9.0% Supervision conditions:none VAT:17.0% MFN tariff:5.5% General tariff:30.0% |
|---|
Synonyms
| m-Chlorobenzophenone |
| Benzophenone,3-chloro |
| 3-ClC6H4COPh |
| 3-CHLOROBENZOPHENONE FOR SYNTHESIS |
| 3-Chlorobenzophenone |
| EINECS 213-809-0 |
| 4-PhCOC6H4Cl |
| MFCD00009816 |
| Methanone, (3-chlorophenyl)phenyl- |
| (3-Chlorophenyl)(phenyl)methanone |
| 1-(m-Chlorobenzoyl)benzene |