Introduction：Basic information about CAS 72835-87-1|Ethyl 2,6-dichlorobenzoylacetate, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Ethyl 2,6-dichlorobenzoylacetate |
|---|
| CAS Number | 72835-87-1 | Molecular Weight | 261.10100 |
|---|
| Density | 1.319 g/cm3 | Boiling Point | 290.6ºC at 760 mmHg |
|---|
| Molecular Formula | C11H10Cl2O3 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 109.7ºC |
|---|
Names
| Name | ethyl 3-(2,6-dichlorophenyl)-3-oxopropanoate |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.319 g/cm3 |
|---|
| Boiling Point | 290.6ºC at 760 mmHg |
|---|
| Molecular Formula | C11H10Cl2O3 |
|---|
| Molecular Weight | 261.10100 |
|---|
| Flash Point | 109.7ºC |
|---|
| Exact Mass | 260.00100 |
|---|
| PSA | 43.37000 |
|---|
| LogP | 3.12930 |
|---|
| InChIKey | GJUHMKHPXHMWQI-UHFFFAOYSA-N |
|---|
| SMILES | CCOC(=O)CC(=O)c1c(Cl)cccc1Cl |
|---|
Safety Information
Customs
| HS Code | 2918300090 |
|---|
| Summary | 2918300090 other carboxylic acids with aldehyde or ketone function but without other oxygen function, their anhydrides, halides, peroxides, peroxyacids and their derivatives。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:30.0% |
|---|
Synonyms
| 2,6-Dichloro-beta-Oxo-Benzenepropanoic Acid Ethyl Ester |
| AC-7796 |
| ethyl 2,6-dichlorobenzoylacetate |
