Introduction：Basic information about CAS 2295-17-2|1,3-Diethyl-1,1,3,3-Tetramethyl Disiloxane, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 1,3-Diethyl-1,1,3,3-Tetramethyl Disiloxane |
|---|
| CAS Number | 2295-17-2 | Molecular Weight | 190.43100 |
|---|
| Density | 0.797 g/cm3 | Boiling Point | 150-156ºC |
|---|
| Molecular Formula | C8H22OSi2 | Melting Point | -120ºC |
|---|
| MSDS | / | Flash Point | 30ºC |
|---|
Names
| Name | ethyl-[ethyl(dimethyl)silyl]oxy-dimethylsilane |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 0.797 g/cm3 |
|---|
| Boiling Point | 150-156ºC |
|---|
| Melting Point | -120ºC |
|---|
| Molecular Formula | C8H22OSi2 |
|---|
| Molecular Weight | 190.43100 |
|---|
| Flash Point | 30ºC |
|---|
| Exact Mass | 190.12100 |
|---|
| PSA | 9.23000 |
|---|
| LogP | 3.45300 |
|---|
| Vapour Pressure | 6.37mmHg at 25°C |
|---|
| Index of Refraction | 1.4012 |
|---|
| InChIKey | XODWWDLLPURTOQ-UHFFFAOYSA-N |
|---|
| SMILES | CC[Si](C)(C)O[Si](C)(C)CC |
|---|
| Storage condition | 2~8℃，Seal |
|---|
Safety Information
| Hazard Codes | Xi |
|---|
| Risk Phrases | 10-36/37/38 |
|---|
| Safety Phrases | 16-26-36 |
|---|
| RIDADR | UN 1993 |
|---|
| HS Code | 2934999090 |
|---|
Customs
| HS Code | 2934999090 |
|---|
| Summary | 2934999090. other heterocyclic compounds. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
|---|
Synonyms
| 1,3-Diethyl-1,1,3,3-tetramethyldisiloxan |
| 1,3-Diaethyl-1,1,3,3-tetramethyl-disiloxan |
| Me2EtSiOSiEtMe2 |
| 1,3-diethyl-1,1,3,3-tetramethyl-disiloxane |
| 1,1,2,2-Tetramethyl-1,2-diaethyl-disiloxan |
| diethyltetramethyldisiloxane |
| 1,3-Diethyl tetramethyl disiloxane |
| Bis-(dimethyl-aethyl-silyl)-aether |
| 1,3-Diethyl-1,1,3,3-Tetramethyl Disiloxane |
